N-(5-hydroxy-3,4,14-trimethoxy-13-oxo-10-tetracyclo[9.5.0.02,7.012,16]hexadeca-1(11),2,4,6,14-pentaenyl)formamide
| Internal ID | 8c60c849-ce81-46bf-9afd-4441a48bc711 |
| Taxonomy | Alkaloids and derivatives > Lumicolchicine alkaloids |
| IUPAC Name | N-(5-hydroxy-3,4,14-trimethoxy-13-oxo-10-tetracyclo[9.5.0.02,7.012,16]hexadeca-1(11),2,4,6,14-pentaenyl)formamide |
| SMILES (Canonical) | COC1=CC2C(C1=O)C3=C2C4=C(C(=C(C=C4CCC3NC=O)O)OC)OC |
| SMILES (Isomeric) | COC1=CC2C(C1=O)C3=C2C4=C(C(=C(C=C4CCC3NC=O)O)OC)OC |
| InChI | InChI=1S/C20H21NO6/c1-25-13-7-10-15-14-9(6-12(23)19(26-2)20(14)27-3)4-5-11(21-8-22)17(15)16(10)18(13)24/h6-8,10-11,16,23H,4-5H2,1-3H3,(H,21,22) |
| InChI Key | NEDMHPAULMNFRL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13688739 g/mol |
| Topological Polar Surface Area (TPSA) | 94.10 Ų |
| XlogP | 1.00 |
| NSC-180532 |
![2D Structure of N-(5-hydroxy-3,4,14-trimethoxy-13-oxo-10-tetracyclo[9.5.0.02,7.012,16]hexadeca-1(11),2,4,6,14-pentaenyl)formamide](https://plantaedb.com/storage/docs/compounds/2023/11/4f3df9b0-854f-11ee-b768-69869ead78b7.jpg "2D Structure of N-(5-hydroxy-3,4,14-trimethoxy-13-oxo-10-tetracyclo[9.5.0.02,7.012,16]hexadeca-1(11),2,4,6,14-pentaenyl)formamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.93% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.03% | 93.40% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.96% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 92.20% | 95.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.96% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.54% | 90.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.25% | 98.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.10% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.46% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.13% | 98.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.09% | 90.71% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 88.01% | 80.96% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.57% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.78% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.83% | 85.14% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.53% | 97.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.47% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.93% | 91.19% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.92% | 86.33% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.74% | 91.07% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.32% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.60% | 93.03% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.57% | 90.24% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.02% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Colchicum decaisnei |
| PubChem | 301814 |
| LOTUS | LTS0081170 |
| wikiData | Q105177837 |