1-(2,4-Dihydroxyphenyl)-3-[4-[4-hydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyl]-2-methoxyphenoxy]phenyl]prop-2-en-1-one
| Internal ID | 230efb19-6a0e-4179-8022-e11c37dc1358 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-[4-[4-hydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyl]-2-methoxyphenoxy]phenyl]prop-2-en-1-one |
| SMILES (Canonical) | COC1=C(C=C(C(=C1)O)C(=O)C=CC2=CC=C(C=C2)O)OC3=CC=C(C=C3)C=CC(=O)C4=C(C=C(C=C4)O)O |
| SMILES (Isomeric) | COC1=C(C=C(C(=C1)O)C(=O)C=CC2=CC=C(C=C2)O)OC3=CC=C(C=C3)C=CC(=O)C4=C(C=C(C=C4)O)O |
| InChI | InChI=1S/C31H24O8/c1-38-30-18-29(37)25(27(35)15-7-19-2-8-21(32)9-3-19)17-31(30)39-23-11-4-20(5-12-23)6-14-26(34)24-13-10-22(33)16-28(24)36/h2-18,32-33,36-37H,1H3 |
| InChI Key | VWFAAFDOTKTTKV-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H24O8 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.14711772 g/mol |
| Topological Polar Surface Area (TPSA) | 134.00 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3194 | P02766 | Transthyretin | 97.36% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.68% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.58% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.45% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.23% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.60% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.45% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.28% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.44% | 95.50% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.09% | 93.99% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.72% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.73% | 99.15% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.94% | 91.07% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.28% | 96.12% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.02% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Searsia laevigata |
| PubChem | 404552 |
| LOTUS | LTS0093972 |
| wikiData | Q105298041 |