2-[[3-(7a-Hydroxy-3-oxo-5-propan-2-yl-1,3a,4,5,6,7-hexahydro-2-benzofuran-4-yl)-2-(hydroxymethyl)prop-2-enoyl]oxymethyl]-6-[3-[[7-(2-carboxy-3-hydroxyprop-1-enyl)-1-oxo-6-propan-2-yl-3,4,5,6,7,7a-hexahydro-2-benzofuran-3a-yl]oxy]-2-(hydroxymethyl)-3-oxoprop-1-enyl]-2-hydroxy-5-propan-2-ylcyclohexane-1-carboxylic acid
| Internal ID | 28ba58f5-8e89-4ddb-a3bd-a25a337e7d13 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
| IUPAC Name | 2-[[3-(7a-hydroxy-3-oxo-5-propan-2-yl-1,3a,4,5,6,7-hexahydro-2-benzofuran-4-yl)-2-(hydroxymethyl)prop-2-enoyl]oxymethyl]-6-[3-[[7-(2-carboxy-3-hydroxyprop-1-enyl)-1-oxo-6-propan-2-yl-3,4,5,6,7,7a-hexahydro-2-benzofuran-3a-yl]oxy]-2-(hydroxymethyl)-3-oxoprop-1-enyl]-2-hydroxy-5-propan-2-ylcyclohexane-1-carboxylic acid |
| SMILES (Canonical) | CC(C)C1CCC2(COC(=O)C2C1C=C(CO)C(=O)OCC3(CCC(C(C3C(=O)O)C=C(CO)C(=O)OC45CCC(C(C4C(=O)OC5)C=C(CO)C(=O)O)C(C)C)C(C)C)O)O |
| SMILES (Isomeric) | CC(C)C1CCC2(COC(=O)C2C1C=C(CO)C(=O)OCC3(CCC(C(C3C(=O)O)C=C(CO)C(=O)OC45CCC(C(C4C(=O)OC5)C=C(CO)C(=O)O)C(C)C)C(C)C)O)O |
| InChI | InChI=1S/C45H64O17/c1-22(2)28-7-10-43(57,19-59-39(53)26(17-47)14-32-29(23(3)4)8-11-44(58)20-60-41(55)35(32)44)34(38(51)52)31(28)15-27(18-48)40(54)62-45-12-9-30(24(5)6)33(13-25(16-46)37(49)50)36(45)42(56)61-21-45/h13-15,22-24,28-36,46-48,57-58H,7-12,16-21H2,1-6H3,(H,49,50)(H,51,52) |
| InChI Key | VUDGRKLUMAAASW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C45H64O17 |
| Molecular Weight | 877.00 g/mol |
| Exact Mass | 876.41435057 g/mol |
| Topological Polar Surface Area (TPSA) | 281.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 98.28% | 96.38% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.81% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.50% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.10% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.13% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.43% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.50% | 95.56% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 89.78% | 97.47% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.75% | 90.08% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.90% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.35% | 97.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.16% | 96.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.60% | 98.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.44% | 91.19% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.13% | 90.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.76% | 89.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.70% | 96.43% |
| CHEMBL5028 | O14672 | ADAM10 | 83.69% | 97.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.37% | 99.23% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.98% | 97.79% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.03% | 93.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.84% | 100.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.24% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162923262 |
| LOTUS | LTS0134102 |
| wikiData | Q104199791 |