cyclo[DL-Ala-Gly-DL-His-DL-Val-DL-Pro-DL-Glu-DL-Tyr-DL-Phe-DL-Val-Gly-DL-xiIle-Gly-DL-xiThr-DL-Pro-DL-xiIle-DL-Ser-DL-Phe-DL-Tyr-Gly-Gly-Gly]
| Internal ID | bb4139ff-f58a-4135-81dc-99a5a477b4b2 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 3-[18,57-dibenzyl-9,63-di(butan-2-yl)-3-(1-hydroxyethyl)-60-(hydroxymethyl)-21,54-bis[(4-hydroxyphenyl)methyl]-36-(1H-imidazol-5-ylmethyl)-42-methyl-2,5,8,11,14,17,20,23,26,32,35,38,41,44,47,50,53,56,59,62,65-henicosaoxo-15,33-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,31,34,37,40,43,46,49,52,55,58,61,64-henicosazatricyclo[64.3.0.027,31]nonahexacontan-24-yl]propanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)NCC(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NCC(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)N3CCCC3C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)N1)C(C)C)CC4=CC=CC=C4)CC5=CC=C(C=C5)O)CCC(=O)O)C(C)C)CC6=CN=CN6)C)CC7=CC=C(C=C7)O)CC8=CC=CC=C8)CO)C(C)CC)C(C)O |
| SMILES (Isomeric) | CCC(C)C1C(=O)NCC(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NCC(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)N3CCCC3C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)N1)C(C)C)CC4=CC=CC=C4)CC5=CC=C(C=C5)O)CCC(=O)O)C(C)C)CC6=CN=CN6)C)CC7=CC=C(C=C7)O)CC8=CC=CC=C8)CO)C(C)CC)C(C)O |
| InChI | InChI=1S/C101H139N23O27/c1-11-55(7)84-98(148)108-50-80(134)119-86(58(10)126)101(151)124-38-20-26-74(124)96(146)122-85(56(8)12-2)99(149)117-72(51-125)94(144)116-68(39-59-21-15-13-16-22-59)90(140)113-67(41-61-27-31-64(127)32-28-61)88(138)106-46-76(130)103-45-75(129)104-47-77(131)110-57(9)87(137)105-48-78(132)111-71(43-63-44-102-52-109-63)93(143)121-83(54(5)6)100(150)123-37-19-25-73(123)95(145)112-66(35-36-81(135)136)89(139)114-69(42-62-29-33-65(128)34-30-62)91(141)115-70(40-60-23-17-14-18-24-60)92(142)120-82(53(3)4)97(147)107-49-79(133)118-84/h13-18,21-24,27-34,44,52-58,66-74,82-86,125-128H,11-12,19-20,25-26,35-43,45-51H2,1-10H3,(H,102,109)(H,103,130)(H,104,129)(H,105,137)(H,106,138)(H,107,147)(H,108,148)(H,110,131)(H,111,132)(H,112,145)(H,113,140)(H,114,139)(H,115,141)(H,116,144)(H,117,149)(H,118,133)(H,119,134)(H,120,142)(H,121,143)(H,122,146)(H,135,136) |
| InChI Key | TVZWTTNULXZYTK-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C101H139N23O27 |
| Molecular Weight | 2107.30 g/mol |
| Exact Mass | 2107.0244311 g/mol |
| Topological Polar Surface Area (TPSA) | 740.00 Ų |
| XlogP | 1.80 |
| Atomic LogP (AlogP) | -6.01 |
| H-Bond Acceptor | 27 |
| H-Bond Donor | 25 |
| Rotatable Bonds | 21 |
| There are no found synonyms. |
![2D Structure of cyclo[DL-Ala-Gly-DL-His-DL-Val-DL-Pro-DL-Glu-DL-Tyr-DL-Phe-DL-Val-Gly-DL-xiIle-Gly-DL-xiThr-DL-Pro-DL-xiIle-DL-Ser-DL-Phe-DL-Tyr-Gly-Gly-Gly]](https://plantaedb.com/storage/docs/compounds/2023/11/4ee41d20-7fe2-11ee-9c6d-519397020b8a.jpg "2D Structure of cyclo[DL-Ala-Gly-DL-His-DL-Val-DL-Pro-DL-Glu-DL-Tyr-DL-Phe-DL-Val-Gly-DL-xiIle-Gly-DL-xiThr-DL-Pro-DL-xiIle-DL-Ser-DL-Phe-DL-Tyr-Gly-Gly-Gly]")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8721 | 87.21% |
| Caco-2 | - | 0.8600 | 86.00% |
| Blood Brain Barrier | - | 0.9750 | 97.50% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.5659 | 56.59% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8167 | 81.67% |
| OATP1B3 inhibitior | + | 0.9244 | 92.44% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.9694 | 96.94% |
| P-glycoprotein inhibitior | + | 0.7417 | 74.17% |
| P-glycoprotein substrate | + | 0.8725 | 87.25% |
| CYP3A4 substrate | + | 0.7251 | 72.51% |
| CYP2C9 substrate | - | 0.6062 | 60.62% |
| CYP2D6 substrate | - | 0.8511 | 85.11% |
| CYP3A4 inhibition | - | 0.7519 | 75.19% |
| CYP2C9 inhibition | - | 0.8300 | 83.00% |
| CYP2C19 inhibition | - | 0.8156 | 81.56% |
| CYP2D6 inhibition | - | 0.8748 | 87.48% |
| CYP1A2 inhibition | - | 0.9028 | 90.28% |
| CYP2C8 inhibition | + | 0.8257 | 82.57% |
| CYP inhibitory promiscuity | - | 0.7776 | 77.76% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8000 | 80.00% |
| Carcinogenicity (trinary) | Non-required | 0.6078 | 60.78% |
| Eye corrosion | - | 0.9897 | 98.97% |
| Eye irritation | - | 0.8953 | 89.53% |
| Skin irritation | - | 0.8045 | 80.45% |
| Skin corrosion | - | 0.9389 | 93.89% |
| Ames mutagenesis | - | 0.6854 | 68.54% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7370 | 73.70% |
| Micronuclear | + | 0.8100 | 81.00% |
| Hepatotoxicity | - | 0.5426 | 54.26% |
| skin sensitisation | - | 0.8970 | 89.70% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | - | 0.6836 | 68.36% |
| Acute Oral Toxicity (c) | III | 0.5998 | 59.98% |
| Estrogen receptor binding | - | 0.5659 | 56.59% |
| Androgen receptor binding | + | 0.7476 | 74.76% |
| Thyroid receptor binding | + | 0.8115 | 81.15% |
| Glucocorticoid receptor binding | + | 0.8441 | 84.41% |
| Aromatase binding | + | 0.8208 | 82.08% |
| PPAR gamma | + | 0.7691 | 76.91% |
| Honey bee toxicity | - | 0.6816 | 68.16% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.6000 | 60.00% |
| Fish aquatic toxicity | + | 0.8829 | 88.29% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.91% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.81% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.56% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 98.31% | 97.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.85% | 90.08% |
| CHEMBL4447 | Q9Y337 | Kallikrein 5 | 96.80% | 87.50% |
| CHEMBL4071 | P08311 | Cathepsin G | 96.78% | 94.64% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 95.42% | 82.38% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 94.43% | 99.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.17% | 95.89% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 93.18% | 94.45% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 91.20% | 90.65% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 91.13% | 92.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.07% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.94% | 97.25% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 90.27% | 96.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.59% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.42% | 86.33% |
| CHEMBL4633 | P22001 | Voltage-gated potassium channel subunit Kv1.3 | 88.63% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.05% | 91.11% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.75% | 97.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.52% | 95.93% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.49% | 93.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.11% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.99% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.41% | 90.17% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 86.40% | 97.43% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.92% | 95.89% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 85.66% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.51% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.37% | 93.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.17% | 96.90% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.08% | 99.18% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.84% | 98.75% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.65% | 97.05% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.58% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.96% | 97.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.62% | 100.00% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.38% | 85.83% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.46% | 91.38% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.97% | 88.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584748 |
| LOTUS | LTS0117602 |
| wikiData | Q77375078 |