[6-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl] acetate
Internal ID | 7ac827b7-80f7-475f-95b1-8d864f0c6cd2 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | [6-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)OC(=O)C)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)O |
SMILES (Isomeric) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)OC(=O)C)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)O |
InChI | InChI=1S/C43H72O15/c1-20(9-10-27(47)39(5,6)53)29-22(46)16-41(8)26-15-23(56-37-34(52)32(50)30(48)24(17-44)57-37)35-38(3,4)28(11-12-43(35)19-42(26,43)14-13-40(29,41)7)58-36-33(51)31(49)25(18-54-36)55-21(2)45/h20,22-37,44,46-53H,9-19H2,1-8H3 |
InChI Key | ONJQQJQKSBOWLH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H72O15 |
Molecular Weight | 829.00 g/mol |
Exact Mass | 828.48712159 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | 2.10 |
Atomic LogP (AlogP) | 1.13 |
H-Bond Acceptor | 15 |
H-Bond Donor | 9 |
Rotatable Bonds | 11 |
There are no found synonyms. |
![2D Structure of [6-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl] acetate 2D Structure of [6-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/4e90eaa0-8084-11ee-8ee9-a3ccc716ac7a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6078 | 60.78% |
Caco-2 | - | 0.8782 | 87.82% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.7286 | 72.86% |
Subcellular localzation | Mitochondria | 0.6939 | 69.39% |
OATP2B1 inhibitior | - | 0.8727 | 87.27% |
OATP1B1 inhibitior | + | 0.8105 | 81.05% |
OATP1B3 inhibitior | + | 0.8998 | 89.98% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.6500 | 65.00% |
BSEP inhibitior | - | 0.5654 | 56.54% |
P-glycoprotein inhibitior | + | 0.7739 | 77.39% |
P-glycoprotein substrate | + | 0.6036 | 60.36% |
CYP3A4 substrate | + | 0.7364 | 73.64% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8804 | 88.04% |
CYP3A4 inhibition | - | 0.9251 | 92.51% |
CYP2C9 inhibition | - | 0.7950 | 79.50% |
CYP2C19 inhibition | - | 0.8502 | 85.02% |
CYP2D6 inhibition | - | 0.9519 | 95.19% |
CYP1A2 inhibition | - | 0.8924 | 89.24% |
CYP2C8 inhibition | + | 0.6746 | 67.46% |
CYP inhibitory promiscuity | - | 0.9717 | 97.17% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6989 | 69.89% |
Eye corrosion | - | 0.9902 | 99.02% |
Eye irritation | - | 0.9080 | 90.80% |
Skin irritation | - | 0.6948 | 69.48% |
Skin corrosion | - | 0.9469 | 94.69% |
Ames mutagenesis | - | 0.5948 | 59.48% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6847 | 68.47% |
Micronuclear | - | 0.8000 | 80.00% |
Hepatotoxicity | - | 0.6889 | 68.89% |
skin sensitisation | - | 0.9134 | 91.34% |
Respiratory toxicity | - | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | - | 0.5500 | 55.00% |
Nephrotoxicity | - | 0.8645 | 86.45% |
Acute Oral Toxicity (c) | I | 0.5431 | 54.31% |
Estrogen receptor binding | + | 0.7081 | 70.81% |
Androgen receptor binding | + | 0.7383 | 73.83% |
Thyroid receptor binding | - | 0.5988 | 59.88% |
Glucocorticoid receptor binding | + | 0.6522 | 65.22% |
Aromatase binding | + | 0.6620 | 66.20% |
PPAR gamma | + | 0.7433 | 74.33% |
Honey bee toxicity | - | 0.5846 | 58.46% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | - | 0.6200 | 62.00% |
Fish aquatic toxicity | + | 0.8557 | 85.57% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.16% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
CHEMBL220 | P22303 | Acetylcholinesterase | 97.24% | 94.45% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.07% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.34% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.13% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.46% | 97.09% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.09% | 95.58% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.01% | 85.14% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.67% | 91.24% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.02% | 96.47% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 92.92% | 98.75% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 92.08% | 82.50% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.95% | 95.71% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 91.87% | 97.79% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.13% | 96.61% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.81% | 89.00% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 89.37% | 99.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.33% | 89.50% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.73% | 92.88% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.53% | 96.77% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.51% | 96.21% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.95% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.40% | 97.14% |
CHEMBL237 | P41145 | Kappa opioid receptor | 86.79% | 98.10% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.45% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.07% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.71% | 100.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.43% | 94.08% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.84% | 100.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.83% | 89.34% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.62% | 94.62% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.58% | 97.29% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.33% | 97.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.21% | 91.19% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 83.14% | 99.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.12% | 96.95% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.08% | 94.33% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.85% | 95.71% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.10% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.84% | 96.00% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 81.69% | 95.69% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.46% | 86.33% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.43% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.14% | 95.89% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.89% | 90.24% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.79% | 97.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.75% | 95.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.44% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus tragacantha |
PubChem | 73816187 |
LOTUS | LTS0026255 |
wikiData | Q105194764 |