9,14,18-Trimethyl-13-(3-methylbut-2-enoyl)-4,12,20-trioxapentacyclo[11.6.1.02,11.05,10.015,19]icosa-2(11),5,7,9-tetraen-3-one
Internal ID | a4ee05de-d195-4da0-85e9-cc250c342cc7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | 9,14,18-trimethyl-13-(3-methylbut-2-enoyl)-4,12,20-trioxapentacyclo[11.6.1.02,11.05,10.015,19]icosa-2(11),5,7,9-tetraen-3-one |
SMILES (Canonical) | CC1CCC2C1C3C4=C(C5=C(C=CC=C5OC4=O)C)OC(C2C)(O3)C(=O)C=C(C)C |
SMILES (Isomeric) | CC1CCC2C1C3C4=C(C5=C(C=CC=C5OC4=O)C)OC(C2C)(O3)C(=O)C=C(C)C |
InChI | InChI=1S/C25H28O5/c1-12(2)11-18(26)25-15(5)16-10-9-14(4)19(16)22(29-25)21-23(30-25)20-13(3)7-6-8-17(20)28-24(21)27/h6-8,11,14-16,19,22H,9-10H2,1-5H3 |
InChI Key | KXBRVHYTQIIVJR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O5 |
Molecular Weight | 408.50 g/mol |
Exact Mass | 408.19367399 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 5.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.08% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.80% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.90% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.37% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.01% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.76% | 94.80% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.54% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.16% | 94.73% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 85.94% | 90.93% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.28% | 91.19% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.98% | 93.56% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.97% | 96.39% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.96% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.62% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.38% | 97.50% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.57% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aphyllocladus denticulatus |
PubChem | 14134075 |
LOTUS | LTS0215425 |
wikiData | Q105147268 |