(4E,6E)-1,7-bis(4-hydroxyphenyl)-4,6-heptadien-3-one
| Internal ID | 377e0026-071e-4f6e-b358-0a9438b6b7d0 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | 1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one |
| SMILES (Canonical) | C1=CC(=CC=C1CCC(=O)C=CC=CC2=CC=C(C=C2)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1CCC(=O)C=CC=CC2=CC=C(C=C2)O)O |
| InChI | InChI=1S/C19H18O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h1-6,8-9,11-14,21-22H,7,10H2 |
| InChI Key | QIROPQQWKBMABC-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 3.90 |
| DTXSID70855509 |
| 1,7-bis(4-hydroxyphenyl)-4,6-heptadien-3-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 95.03% | 92.51% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.55% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.57% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 88.82% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.87% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.49% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.62% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.16% | 95.50% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.04% | 85.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.48% | 91.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.30% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.81% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.08% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curcuma kwangsiensis |
| Dioscorea oppositifolia |
| Musa acuminata |
| PubChem | 71447176 |
| LOTUS | LTS0171283 |
| wikiData | Q82850476 |