(1R,2R,4R,6E,8R,11S,12R)-8-hydroxy-4,8,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-6-ene-5,13-dione
Internal ID | 3d5291c2-0a84-4593-b045-7118a6be8bfc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (1R,2R,4R,6E,8R,11S,12R)-8-hydroxy-4,8,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-6-ene-5,13-dione |
SMILES (Canonical) | CC1C2CCC(C=CC(=O)C3(C(C2OC1=O)O3)C)(C)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]2CC[C@@](/C=C/C(=O)[C@]3([C@@H]([C@@H]2OC1=O)O3)C)(C)O |
InChI | InChI=1S/C15H20O5/c1-8-9-4-6-14(2,18)7-5-10(16)15(3)12(20-15)11(9)19-13(8)17/h5,7-9,11-12,18H,4,6H2,1-3H3/b7-5+/t8-,9+,11-,12-,14-,15+/m1/s1 |
InChI Key | UKXGHOZXFVBGQS-XYTIPOMBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O5 |
Molecular Weight | 280.32 g/mol |
Exact Mass | 280.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 76.10 Ų |
XlogP | 0.80 |
There are no found synonyms. |
![2D Structure of (1R,2R,4R,6E,8R,11S,12R)-8-hydroxy-4,8,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-6-ene-5,13-dione 2D Structure of (1R,2R,4R,6E,8R,11S,12R)-8-hydroxy-4,8,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-6-ene-5,13-dione](https://plantaedb.com/storage/docs/compounds/2023/11/4e620ed0-86e8-11ee-a115-2d48d2a870b2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.73% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.28% | 97.25% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.87% | 91.49% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 87.76% | 92.51% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.66% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.78% | 96.77% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.59% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.43% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.23% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.31% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.69% | 94.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.45% | 99.23% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.61% | 93.04% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.21% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia pallens |
PubChem | 162907939 |
LOTUS | LTS0224111 |
wikiData | Q105274963 |