methyl (4S,5Z,6S)-5-ethylidene-4-[2-[2-[4-[2-[(2S,3Z,4S)-3-ethylidene-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxy-3-[2-[(2S,3E,4S)-3-ethylidene-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxyphenyl]ethoxy]-2-oxoethyl]-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate
Internal ID | 05a6ca3b-2270-4311-8e45-bcf923cd3a42 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | methyl (4S,5Z,6S)-5-ethylidene-4-[2-[2-[4-[2-[(2S,3Z,4S)-3-ethylidene-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxy-3-[2-[(2S,3E,4S)-3-ethylidene-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxyphenyl]ethoxy]-2-oxoethyl]-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC(=C(C=C3)OC(=O)CC4C(=COC(C4=CC)OC5C(C(C(C(O5)CO)O)O)O)C(=O)OC)OC(=O)CC6C(=COC(C6=CC)OC7C(C(C(C(O7)CO)O)O)O)C(=O)OC |
SMILES (Isomeric) | C/C=C\1/[C@@H](C(=CO[C@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC(=C(C=C3)OC(=O)C[C@@H]\4C(=CO[C@H](/C4=C\C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C(=O)OC)OC(=O)C[C@@H]\6C(=CO[C@H](/C6=C/C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C(=O)OC |
InChI | InChI=1S/C59H76O33/c1-7-25-28(31(51(75)78-4)21-82-54(25)90-57-48(72)45(69)42(66)36(18-60)87-57)15-39(63)81-13-12-24-10-11-34(85-40(64)16-29-26(8-2)55(83-22-32(29)52(76)79-5)91-58-49(73)46(70)43(67)37(19-61)88-58)35(14-24)86-41(65)17-30-27(9-3)56(84-23-33(30)53(77)80-6)92-59-50(74)47(71)44(68)38(20-62)89-59/h7-11,14,21-23,28-30,36-38,42-50,54-62,66-74H,12-13,15-20H2,1-6H3/b25-7-,26-8-,27-9+/t28-,29-,30-,36+,37+,38+,42+,43+,44+,45-,46-,47-,48+,49+,50+,54-,55-,56-,57-,58-,59-/m0/s1 |
InChI Key | YBCYJRVORLVMDL-LZLAEFSBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H76O33 |
Molecular Weight | 1313.20 g/mol |
Exact Mass | 1312.4268849 g/mol |
Topological Polar Surface Area (TPSA) | 484.00 Ų |
XlogP | -3.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.39% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 96.25% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.98% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 94.72% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.65% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.47% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.40% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.68% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.30% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.99% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.97% | 90.71% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.31% | 96.90% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.61% | 89.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.26% | 95.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.24% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.95% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.12% | 94.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.89% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum polyanthum |
PubChem | 102316571 |
LOTUS | LTS0074929 |
wikiData | Q105345766 |