1-O-Hexopyranosylhexitol
| Internal ID | efafe748-7402-4ab8-b8bd-cef3220308e1 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
| IUPAC Name | 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4,5-pentol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H24O11/c13-1-4(15)7(17)8(18)5(16)3-22-12-11(21)10(20)9(19)6(2-14)23-12/h4-21H,1-3H2 |
| InChI Key | SERLAGPUMNYUCK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H24O11 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.13186158 g/mol |
| Topological Polar Surface Area (TPSA) | 201.00 Ų |
| XlogP | -5.20 |
| 1-O-alpha-D-Glucopyranosyl-D-mannitol |
| 64519-82-0 |
| 1-O-beta-D-glucopyranosyl-D-mannitol |
| (2S,3R,4R,5R)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4,5-pentol |
| 28971-30-4 |
| 1-O-Hexopyranosylhexitol |
| SCHEMBL22516557 |
| DTXSID10860798 |
| GPM |
| LMFA13010063 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.12% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.33% | 91.11% |
| CHEMBL3589 | P55263 | Adenosine kinase | 87.35% | 98.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.86% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.04% | 99.17% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.39% | 86.92% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.69% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 4454759 |
| LOTUS | LTS0077294 |
| wikiData | Q105251455 |