[20-Acetyloxy-6-(furan-3-yl)-11,18,19-trihydroxy-5,10,14-trimethyl-3,8-dioxo-16-oxapentacyclo[12.3.3.01,13.02,10.05,9]icosan-15-yl] 2-methylpropanoate
Internal ID | ce35c9ff-7186-4777-8b57-47bc320f35eb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [20-acetyloxy-6-(furan-3-yl)-11,18,19-trihydroxy-5,10,14-trimethyl-3,8-dioxo-16-oxapentacyclo[12.3.3.01,13.02,10.05,9]icosan-15-yl] 2-methylpropanoate |
SMILES (Canonical) | CC(C)C(=O)OC1C2(C3CC(C4(C5C(=O)CC(C5(CC(=O)C4C3(CO1)C(C(C2OC(=O)C)O)O)C)C6=COC=C6)C)O)C |
SMILES (Isomeric) | CC(C)C(=O)OC1C2(C3CC(C4(C5C(=O)CC(C5(CC(=O)C4C3(CO1)C(C(C2OC(=O)C)O)O)C)C6=COC=C6)C)O)C |
InChI | InChI=1S/C32H42O11/c1-14(2)27(39)43-28-30(5)20-10-21(36)31(6)23-18(34)9-17(16-7-8-40-12-16)29(23,4)11-19(35)24(31)32(20,13-41-28)25(38)22(37)26(30)42-15(3)33/h7-8,12,14,17,20-26,28,36-38H,9-11,13H2,1-6H3 |
InChI Key | VTNHHDHTNFVQFK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H42O11 |
Molecular Weight | 602.70 g/mol |
Exact Mass | 602.27271215 g/mol |
Topological Polar Surface Area (TPSA) | 170.00 Ų |
XlogP | 1.10 |
There are no found synonyms. |
![2D Structure of [20-Acetyloxy-6-(furan-3-yl)-11,18,19-trihydroxy-5,10,14-trimethyl-3,8-dioxo-16-oxapentacyclo[12.3.3.01,13.02,10.05,9]icosan-15-yl] 2-methylpropanoate 2D Structure of [20-Acetyloxy-6-(furan-3-yl)-11,18,19-trihydroxy-5,10,14-trimethyl-3,8-dioxo-16-oxapentacyclo[12.3.3.01,13.02,10.05,9]icosan-15-yl] 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/4d6df190-86b3-11ee-8f5d-b36c88a02714.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.68% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.48% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.82% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 96.51% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.88% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.08% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.24% | 96.77% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.11% | 89.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.27% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.58% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.08% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.50% | 90.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.03% | 91.49% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.73% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.11% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.72% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.86% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.13% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.94% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.82% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.70% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.51% | 91.24% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.26% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 163042093 |
LOTUS | LTS0180604 |
wikiData | Q105292880 |