[(1S,2R,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] butanoate
Internal ID | ca8b8b90-678b-4ac8-a9d7-a54c988fbdf4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | [(1S,2R,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] butanoate |
SMILES (Canonical) | CCCC(=O)OC1CCC(=CC2C(C(C(=O)O2)C)(C(C3C1(C(CC=C3C)OC(=O)C)C)OC(=O)C)O)C |
SMILES (Isomeric) | CCCC(=O)O[C@@H]1CC/C(=C\[C@H]2[C@@]([C@H](C(=O)O2)C)([C@@H]([C@@H]3[C@@]1([C@H](CC=C3C)OC(=O)C)C)OC(=O)C)O)/C |
InChI | InChI=1S/C28H40O9/c1-8-9-23(31)36-21-12-10-15(2)14-22-28(33,17(4)26(32)37-22)25(35-19(6)30)24-16(3)11-13-20(27(21,24)7)34-18(5)29/h11,14,17,20-22,24-25,33H,8-10,12-13H2,1-7H3/b15-14-/t17-,20-,21+,22-,24+,25+,27+,28-/m0/s1 |
InChI Key | WUAAFCGTSYYMLQ-LOIFNGLMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H40O9 |
Molecular Weight | 520.60 g/mol |
Exact Mass | 520.26723285 g/mol |
Topological Polar Surface Area (TPSA) | 125.00 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of [(1S,2R,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] butanoate 2D Structure of [(1S,2R,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] butanoate](https://plantaedb.com/storage/docs/compounds/2023/11/4d53d9e0-8537-11ee-ac4b-b78842777328.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.32% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.26% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.62% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.03% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 92.86% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.48% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.99% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.02% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.59% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.49% | 95.56% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.97% | 89.63% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.00% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.99% | 97.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.71% | 96.43% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.47% | 92.94% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.44% | 94.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.41% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.09% | 91.19% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.87% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.75% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.74% | 94.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.70% | 90.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.13% | 99.17% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.82% | 89.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.21% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper retrofractum |
PubChem | 21778081 |
LOTUS | LTS0210104 |
wikiData | Q105193292 |