(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-2-[[(3S,5R,8R,9R,10R,13R,14R,17S)-17-[(2S,3R,5S)-2-butoxy-3-hydroxy-5-(2-methylprop-1-enyl)oxolan-3-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | b8ad4aaa-d135-42dd-9486-e8c75b5282f1 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-2-[[(3S,5R,8R,9R,10R,13R,14R,17S)-17-[(2S,3R,5S)-2-butoxy-3-hydroxy-5-(2-methylprop-1-enyl)oxolan-3-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CCCCOC1C(CC(O1)C=C(C)C)(C2CCC3(C2CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)CO)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)C)O |
SMILES (Isomeric) | CCCCO[C@@H]1[C@@](C[C@H](O1)C=C(C)C)([C@H]2CC[C@@]3([C@@H]2CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)C)C)C)O |
InChI | InChI=1S/C51H86O17/c1-10-11-20-61-46-51(60,22-27(64-46)21-25(2)3)29-14-18-49(8)28(29)12-13-33-48(7)17-16-34(47(5,6)32(48)15-19-50(33,49)9)66-45-42(68-44-40(59)38(57)35(54)26(4)63-44)41(37(56)31(23-52)65-45)67-43-39(58)36(55)30(53)24-62-43/h21,26-46,52-60H,10-20,22-24H2,1-9H3/t26-,27+,28+,29-,30+,31+,32-,33+,34-,35-,36-,37+,38+,39+,40+,41-,42+,43-,44-,45-,46-,48-,49+,50+,51+/m0/s1 |
InChI Key | XCYYAAAJROIVTP-JDEUSJJSSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C51H86O17 |
Molecular Weight | 971.20 g/mol |
Exact Mass | 970.58650127 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | 4.40 |
Atomic LogP (AlogP) | 2.80 |
H-Bond Acceptor | 17 |
H-Bond Donor | 9 |
Rotatable Bonds | 13 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-2-[[(3S,5R,8R,9R,10R,13R,14R,17S)-17-[(2S,3R,5S)-2-butoxy-3-hydroxy-5-(2-methylprop-1-enyl)oxolan-3-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-2-[[(3S,5R,8R,9R,10R,13R,14R,17S)-17-[(2S,3R,5S)-2-butoxy-3-hydroxy-5-(2-methylprop-1-enyl)oxolan-3-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/4d305ad0-7fdb-11ee-ac93-351a0c8cc5ab.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8762 | 87.62% |
Caco-2 | - | 0.8904 | 89.04% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.7429 | 74.29% |
Subcellular localzation | Mitochondria | 0.7367 | 73.67% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8202 | 82.02% |
OATP1B3 inhibitior | + | 0.9171 | 91.71% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | + | 0.8568 | 85.68% |
P-glycoprotein inhibitior | + | 0.7586 | 75.86% |
P-glycoprotein substrate | + | 0.6436 | 64.36% |
CYP3A4 substrate | + | 0.7551 | 75.51% |
CYP2C9 substrate | - | 0.7890 | 78.90% |
CYP2D6 substrate | - | 0.8406 | 84.06% |
CYP3A4 inhibition | - | 0.7868 | 78.68% |
CYP2C9 inhibition | - | 0.8293 | 82.93% |
CYP2C19 inhibition | - | 0.8732 | 87.32% |
CYP2D6 inhibition | - | 0.9197 | 91.97% |
CYP1A2 inhibition | - | 0.8993 | 89.93% |
CYP2C8 inhibition | + | 0.7904 | 79.04% |
CYP inhibitory promiscuity | - | 0.8228 | 82.28% |
UGT catelyzed | - | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5695 | 56.95% |
Eye corrosion | - | 0.9891 | 98.91% |
Eye irritation | - | 0.9052 | 90.52% |
Skin irritation | - | 0.5958 | 59.58% |
Skin corrosion | - | 0.9421 | 94.21% |
Ames mutagenesis | - | 0.6600 | 66.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7933 | 79.33% |
Micronuclear | - | 0.8300 | 83.00% |
Hepatotoxicity | - | 0.8375 | 83.75% |
skin sensitisation | - | 0.9020 | 90.20% |
Respiratory toxicity | + | 0.6556 | 65.56% |
Reproductive toxicity | + | 0.8667 | 86.67% |
Mitochondrial toxicity | - | 0.5250 | 52.50% |
Nephrotoxicity | - | 0.9378 | 93.78% |
Acute Oral Toxicity (c) | I | 0.6136 | 61.36% |
Estrogen receptor binding | + | 0.7935 | 79.35% |
Androgen receptor binding | + | 0.7430 | 74.30% |
Thyroid receptor binding | - | 0.5480 | 54.80% |
Glucocorticoid receptor binding | + | 0.7016 | 70.16% |
Aromatase binding | + | 0.6641 | 66.41% |
PPAR gamma | + | 0.7821 | 78.21% |
Honey bee toxicity | - | 0.6159 | 61.59% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | + | 0.6191 | 61.91% |
Fish aquatic toxicity | + | 0.9620 | 96.20% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.55% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.70% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.13% | 95.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.92% | 96.61% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 94.66% | 91.24% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.74% | 92.86% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.73% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.71% | 97.09% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 92.18% | 97.53% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.10% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 91.07% | 98.95% |
CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 90.91% | 95.52% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 90.76% | 92.88% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.22% | 95.50% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.05% | 97.29% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 89.85% | 97.86% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.62% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.45% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.50% | 99.17% |
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 87.96% | 91.83% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.43% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.36% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.15% | 96.77% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 86.86% | 89.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.53% | 95.89% |
CHEMBL3589 | P55263 | Adenosine kinase | 86.10% | 98.05% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.69% | 91.03% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.64% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.63% | 95.89% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 84.42% | 95.36% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.90% | 92.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.62% | 97.36% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.32% | 92.98% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.20% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.87% | 96.21% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 82.52% | 80.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.41% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.15% | 89.05% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.45% | 93.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.35% | 95.83% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.24% | 92.32% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.12% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gynostemma pentaphyllum |
PubChem | 162944070 |
LOTUS | LTS0087558 |
wikiData | Q105325564 |