[(1R,4Z,8E,10Z,12S,15R,17S)-5,12-dimethyl-3-oxo-17-[(4R)-2-oxo-1,3-thiazolidin-4-yl]-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl] N-(2-chloroethyl)carbamate
| Internal ID | 351dabd6-62a2-44d4-a1d2-dd2a9f14d6f5 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | [(1R,4Z,8E,10Z,12S,15R,17S)-5,12-dimethyl-3-oxo-17-[(4R)-2-oxo-1,3-thiazolidin-4-yl]-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl] N-(2-chloroethyl)carbamate |
| SMILES (Canonical) | CC1CCC2CC(CC(O2)(C3CSC(=O)N3)OC(=O)NCCCl)OC(=O)C=C(CCC=CC=C1)C |
| SMILES (Isomeric) | C[C@H]/1CC[C@@H]2C[C@H](C[C@@](O2)([C@@H]3CSC(=O)N3)OC(=O)NCCCl)OC(=O)/C=C(\CC/C=C/C=C1)/C |
| InChI | InChI=1S/C25H35ClN2O6S/c1-17-7-5-3-4-6-8-18(2)13-22(29)32-20-14-19(10-9-17)33-25(15-20,21-16-35-24(31)28-21)34-23(30)27-12-11-26/h3-5,7,13,17,19-21H,6,8-12,14-16H2,1-2H3,(H,27,30)(H,28,31)/b4-3+,7-5-,18-13-/t17-,19-,20-,21+,25+/m1/s1 |
| InChI Key | CHHHDCFJTWVFPK-ODVPECJOSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C25H35ClN2O6S |
| Molecular Weight | 527.10 g/mol |
| Exact Mass | 526.1904357 g/mol |
| Topological Polar Surface Area (TPSA) | 128.00 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.47% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.27% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.85% | 89.34% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.77% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.45% | 94.45% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 90.06% | 94.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.94% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.61% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.53% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.21% | 85.14% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.64% | 89.63% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.99% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.67% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.21% | 99.23% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.02% | 96.77% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.96% | 94.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.32% | 90.08% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.48% | 94.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.75% | 95.50% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 81.41% | 95.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.33% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.89% | 96.90% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.81% | 98.75% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.43% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 24853747 |
| LOTUS | LTS0080717 |
| wikiData | Q104921160 |