(2R,3R,10S,11S,18S,19S)-3,11,19-tris(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-7,13,15,23-tetrol
| Internal ID | 025b36ab-fa8f-416e-a823-5cbc0dc1836d |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | (2R,3R,10S,11S,18S,19S)-3,11,19-tris(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-7,13,15,23-tetrol |
| SMILES (Canonical) | C1=CC(=CC=C1C2C3C(C(C4=C3C=C(C=C4OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC=C(C=C6)O)C7=C8C(C(OC8=CC(=C7)O)C9=CC=C(C=C9)O)C1=C2C(=CC(=C1)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1[C@@H]2[C@@H]3[C@H]([C@@H](C4=C3C=C(C=C4O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)C6=CC=C(C=C6)O)C7=C8[C@@H]([C@H](OC8=CC(=C7)O)C9=CC=C(C=C9)O)C1=C2C(=CC(=C1)O)O)O |
| InChI | InChI=1S/C48H42O14/c49-19-35-44(57)45(58)46(59)48(62-35)61-34-18-28(55)14-30-39(34)37(21-3-9-24(51)10-4-21)42-31-15-27(54)17-33-40(31)43(47(60-33)22-5-11-25(52)12-6-22)29-13-26(53)16-32(56)38(29)36(41(30)42)20-1-7-23(50)8-2-20/h1-18,35-37,41-59H,19H2/t35-,36+,37-,41-,42+,43+,44-,45+,46-,47-,48-/m1/s1 |
| InChI Key | GXFQSZARSVJDKW-XQJGVNTDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C48H42O14 |
| Molecular Weight | 842.80 g/mol |
| Exact Mass | 842.25745601 g/mol |
| Topological Polar Surface Area (TPSA) | 250.00 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.33% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.42% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.19% | 83.82% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.06% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.56% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.86% | 95.93% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.85% | 99.17% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.82% | 95.78% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.68% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.40% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.15% | 89.00% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.23% | 97.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.73% | 90.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.27% | 97.36% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.59% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.62% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.61% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 81.28% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vatica pauciflora |
| PubChem | 21674276 |
| LOTUS | LTS0222763 |
| wikiData | Q105023042 |