[(3S,5S,8S,9R,10R,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
Internal ID | a73ca6b3-5dc6-403e-a68e-c2c3041b29fd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3S,5S,8S,9R,10R,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CC(CCC=C(C)C)C1CCC2(C1(CCC3C2CCC4C3(CCC(C4(C)C)OC(=O)C)C)C)C |
SMILES (Isomeric) | C[C@@H](CCC=C(C)C)[C@H]1CC[C@]2([C@]1(CC[C@@H]3[C@@H]2CC[C@H]4[C@@]3(CC[C@@H](C4(C)C)OC(=O)C)C)C)C |
InChI | InChI=1S/C32H54O2/c1-21(2)11-10-12-22(3)24-15-19-32(9)26-13-14-27-29(5,6)28(34-23(4)33)17-18-30(27,7)25(26)16-20-31(24,32)8/h11,22,24-28H,10,12-20H2,1-9H3/t22-,24+,25+,26-,27+,28-,30+,31-,32+/m0/s1 |
InChI Key | NHJFCZBYRRYYOB-ZWLDWGMCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H54O2 |
Molecular Weight | 470.80 g/mol |
Exact Mass | 470.412380961 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 10.70 |
There are no found synonyms. |
![2D Structure of [(3S,5S,8S,9R,10R,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate 2D Structure of [(3S,5S,8S,9R,10R,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/4c93d820-876a-11ee-82ec-e58b504873f8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.23% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.36% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.48% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.71% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.47% | 97.25% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.18% | 91.19% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.38% | 89.50% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.26% | 97.93% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.75% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.63% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.23% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.17% | 92.62% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.95% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.69% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.29% | 82.69% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.21% | 93.56% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.65% | 95.50% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.55% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.49% | 97.09% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 83.42% | 97.47% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.34% | 93.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.21% | 98.10% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.00% | 94.33% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.43% | 97.50% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.42% | 99.18% |
CHEMBL236 | P41143 | Delta opioid receptor | 81.28% | 99.35% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.11% | 82.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.67% | 96.61% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.60% | 94.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.10% | 95.89% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.07% | 96.38% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.05% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Marshallia grandiflora |
PubChem | 163084324 |
LOTUS | LTS0076233 |
wikiData | Q105179403 |