12-hydroxy-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-10-carbaldehyde
| Internal ID | f9607c3d-3c17-41f2-bda8-58e8f286f490 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Pyridoacridines > Pyrido[2,3,4-kl]acridines |
| IUPAC Name | 12-hydroxy-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-10-carbaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H10N2O2/c19-8-9-7-13(20)16-14-11(5-6-17-16)10-3-1-2-4-12(10)18-15(9)14/h1-8,18,20H |
| InChI Key | YKIJUADOHYRDSQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.074227566 g/mol |
| Topological Polar Surface Area (TPSA) | 62.20 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of 12-hydroxy-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-10-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/4c82df10-865a-11ee-b834-9b1eebc27bfb.jpg "2D Structure of 12-hydroxy-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene-10-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.56% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.41% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.64% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.53% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.34% | 89.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 96.02% | 98.11% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 94.46% | 93.24% |
| CHEMBL240 | Q12809 | HERG | 91.88% | 89.76% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.80% | 98.75% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.29% | 94.62% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 88.94% | 97.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.66% | 91.71% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 88.03% | 96.47% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.70% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.49% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.70% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.93% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.47% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.91% | 96.09% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 83.04% | 85.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.95% | 99.15% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 81.60% | 88.00% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.27% | 89.44% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.03% | 88.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.52% | 93.99% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 80.41% | 95.00% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 80.34% | 81.14% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.15% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5324320 |
| LOTUS | LTS0050237 |
| wikiData | Q105349706 |