(1S,7R,11S,12R,13R)-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-12,13-dihydroxy-2,2,10-trimethyl-5-(3-methylbut-2-enyl)-3-oxatetracyclo[9.2.1.04,13.07,12]tetradeca-4,9-dien-6-one
| Internal ID | 68e8d476-d43f-4abe-bb5d-9fae3008ad48 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1S,7R,11S,12R,13R)-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-12,13-dihydroxy-2,2,10-trimethyl-5-(3-methylbut-2-enyl)-3-oxatetracyclo[9.2.1.04,13.07,12]tetradeca-4,9-dien-6-one |
| SMILES (Canonical) | CC1=CCC2(C(=O)C(=C3C4(C2(C1CC4C(O3)(C)C)O)O)CC=C(C)C)CC=C(C)CCC=C(C)C |
| SMILES (Isomeric) | CC1=CC[C@]2(C(=O)C(=C3[C@@]4([C@]2([C@H]1C[C@@H]4C(O3)(C)C)O)O)CC=C(C)C)C/C=C(\C)/CCC=C(C)C |
| InChI | InChI=1S/C31H44O4/c1-19(2)10-9-11-21(5)14-16-29-17-15-22(6)24-18-25-28(7,8)35-27(30(25,33)31(24,29)34)23(26(29)32)13-12-20(3)4/h10,12,14-15,24-25,33-34H,9,11,13,16-18H2,1-8H3/b21-14+/t24-,25+,29-,30-,31+/m0/s1 |
| InChI Key | HZWODYNDACKNRH-MVJABNQZSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.32395988 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 5.40 |
| There are no found synonyms. |
![2D Structure of (1S,7R,11S,12R,13R)-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-12,13-dihydroxy-2,2,10-trimethyl-5-(3-methylbut-2-enyl)-3-oxatetracyclo[9.2.1.04,13.07,12]tetradeca-4,9-dien-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/4c5056c0-8662-11ee-ab45-e956376b436c.jpg "2D Structure of (1S,7R,11S,12R,13R)-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-12,13-dihydroxy-2,2,10-trimethyl-5-(3-methylbut-2-enyl)-3-oxatetracyclo[9.2.1.04,13.07,12]tetradeca-4,9-dien-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.97% | 85.30% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.44% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.43% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.45% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.83% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.55% | 94.73% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.73% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.07% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.51% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.49% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.72% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.71% | 85.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.96% | 90.08% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.12% | 96.90% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.65% | 86.33% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.27% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum erectum |
| PubChem | 10322920 |
| LOTUS | LTS0103412 |
| wikiData | Q105035922 |