(4bS,8aS)-3-methoxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-4-ol
Internal ID | b1943bdb-d038-4682-bc2c-a1fdc451ffba |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (4bS,8aS)-3-methoxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-4-ol |
SMILES (Canonical) | CC(C)C1=C(C(=C2C(=C1)C=CC3C2(CCCC3(C)C)C)O)OC |
SMILES (Isomeric) | CC(C)C1=C(C(=C2C(=C1)C=C[C@@H]3[C@@]2(CCCC3(C)C)C)O)OC |
InChI | InChI=1S/C21H30O2/c1-13(2)15-12-14-8-9-16-20(3,4)10-7-11-21(16,5)17(14)18(22)19(15)23-6/h8-9,12-13,16,22H,7,10-11H2,1-6H3/t16-,21-/m0/s1 |
InChI Key | QSVFHUPTMSJXTL-KKSFZXQISA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O2 |
Molecular Weight | 314.50 g/mol |
Exact Mass | 314.224580195 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 6.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.18% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.48% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.79% | 97.25% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.40% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 88.14% | 98.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.42% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.13% | 95.89% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.94% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.73% | 94.75% |
CHEMBL2535 | P11166 | Glucose transporter | 86.15% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.69% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.22% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.21% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.93% | 93.99% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.00% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.41% | 92.62% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.50% | 91.03% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.37% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.36% | 90.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.55% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chamaecyparis obtusa |
PubChem | 14827287 |
LOTUS | LTS0195199 |
wikiData | Q105227405 |