(4bR,10aS)-9-hydroxy-7-methoxy-11,11-dimethyl-10,10a-dihydro-4bH-benzo[b]fluoren-5-one
Internal ID | 6ac3e3dd-f326-4798-91f7-4031b285b358 |
Taxonomy | Benzenoids > Fluorenes |
IUPAC Name | (4bR,10aS)-9-hydroxy-7-methoxy-11,11-dimethyl-10,10a-dihydro-4bH-benzo[b]fluoren-5-one |
SMILES (Canonical) | CC1(C2CC3=C(C=C(C=C3O)OC)C(=O)C2C4=CC=CC=C41)C |
SMILES (Isomeric) | CC1([C@H]2CC3=C(C=C(C=C3O)OC)C(=O)[C@H]2C4=CC=CC=C41)C |
InChI | InChI=1S/C20H20O3/c1-20(2)15-7-5-4-6-12(15)18-16(20)10-13-14(19(18)22)8-11(23-3)9-17(13)21/h4-9,16,18,21H,10H2,1-3H3/t16-,18-/m0/s1 |
InChI Key | YFNNKWLFVPQLOR-WMZOPIPTSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H20O3 |
Molecular Weight | 308.40 g/mol |
Exact Mass | 308.14124450 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.10 |
There are no found synonyms. |
![2D Structure of (4bR,10aS)-9-hydroxy-7-methoxy-11,11-dimethyl-10,10a-dihydro-4bH-benzo[b]fluoren-5-one 2D Structure of (4bR,10aS)-9-hydroxy-7-methoxy-11,11-dimethyl-10,10a-dihydro-4bH-benzo[b]fluoren-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/4br10as-9-hydroxy-7-methoxy-1111-dimethyl-1010a-dihydro-4bh-benzobfluoren-5-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.28% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.84% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.99% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 95.34% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.60% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 90.51% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.09% | 86.33% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 89.21% | 92.67% |
CHEMBL240 | Q12809 | HERG | 87.73% | 89.76% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.69% | 99.23% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.06% | 82.69% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.97% | 93.31% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.86% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.65% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.44% | 90.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 82.77% | 92.68% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.73% | 93.40% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.68% | 91.07% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.66% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.53% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.20% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carex distachya |
PubChem | 162968148 |
LOTUS | LTS0108451 |
wikiData | Q105347699 |