(4bR,10aR)-4b,9-dihydroxy-7-methoxy-11,11-dimethyl-10,10a-dihydrobenzo[b]fluoren-5-one
| Internal ID | b7bb772f-0ea0-42dc-a174-a3eaef15536d |
| Taxonomy | Benzenoids > Fluorenes |
| IUPAC Name | (4bR,10aR)-4b,9-dihydroxy-7-methoxy-11,11-dimethyl-10,10a-dihydrobenzo[b]fluoren-5-one |
| SMILES (Canonical) | CC1(C2CC3=C(C=C(C=C3O)OC)C(=O)C2(C4=CC=CC=C41)O)C |
| SMILES (Isomeric) | CC1([C@H]2CC3=C(C=C(C=C3O)OC)C(=O)[C@@]2(C4=CC=CC=C41)O)C |
| InChI | InChI=1S/C20H20O4/c1-19(2)14-6-4-5-7-15(14)20(23)17(19)10-12-13(18(20)22)8-11(24-3)9-16(12)21/h4-9,17,21,23H,10H2,1-3H3/t17-,20+/m1/s1 |
| InChI Key | WCFDSFKWIUXBOY-XLIONFOSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of (4bR,10aR)-4b,9-dihydroxy-7-methoxy-11,11-dimethyl-10,10a-dihydrobenzo[b]fluoren-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/4br10ar-4b9-dihydroxy-7-methoxy-1111-dimethyl-1010a-dihydrobenzobfluoren-5-one.jpg "2D Structure of (4bR,10aR)-4b,9-dihydroxy-7-methoxy-11,11-dimethyl-10,10a-dihydrobenzo[b]fluoren-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.60% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.45% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.38% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.37% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.91% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.83% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.70% | 97.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.29% | 99.15% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.84% | 82.69% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.73% | 93.99% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.24% | 97.14% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.71% | 85.14% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.51% | 93.40% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.34% | 99.23% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.06% | 92.67% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.88% | 91.07% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.03% | 93.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.78% | 95.89% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.74% | 91.49% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.21% | 91.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Carex distachya |
| PubChem | 163038050 |
| LOTUS | LTS0075460 |
| wikiData | Q105301405 |