4beta-Carboxy-19-nortotarol
Internal ID | 5df963e1-cae3-47b8-8c3a-8745146501f9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (1S,4aS,10aR)-7-hydroxy-1,4a-dimethyl-8-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
SMILES (Canonical) | CC(C)C1=C(C=CC2=C1CCC3C2(CCCC3(C)C(=O)O)C)O |
SMILES (Isomeric) | CC(C)C1=C(C=CC2=C1CC[C@@H]3[C@@]2(CCC[C@]3(C)C(=O)O)C)O |
InChI | InChI=1S/C20H28O3/c1-12(2)17-13-6-9-16-19(3,14(13)7-8-15(17)21)10-5-11-20(16,4)18(22)23/h7-8,12,16,21H,5-6,9-11H2,1-4H3,(H,22,23)/t16-,19-,20+/m1/s1 |
InChI Key | ODFSGGBGOKCJFA-AHRSYUTCSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H28O3 |
Molecular Weight | 316.40 g/mol |
Exact Mass | 316.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 5.20 |
55102-39-1 |
(1S,4aS,10aR)-7-hydroxy-1,4a-dimethyl-8-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
CHEMBL517672 |
AKOS040761158 |
FS-8722 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.54% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.74% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.52% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.49% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 90.94% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.08% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.56% | 90.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.60% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.01% | 91.19% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.40% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.75% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.13% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.63% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.35% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.49% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nageia nagi |
Podocarpus macrophyllus |
Podocarpus neriifolius |
PubChem | 15694359 |
LOTUS | LTS0086678 |
wikiData | Q105189822 |