2-[6-[[3,4,8,8a-Tetramethyl-4-[3-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxypent-4-enyl]-1,2,3,4a,5,6-hexahydronaphthalen-1-yl]oxy]-4-hydroxy-2-methyl-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
| Internal ID | 44043549-bb8e-4d0b-b3e4-aefdb5c9b028 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
| IUPAC Name | 2-[6-[[3,4,8,8a-tetramethyl-4-[3-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxypent-4-enyl]-1,2,3,4a,5,6-hexahydronaphthalen-1-yl]oxy]-4-hydroxy-2-methyl-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1CC(C2(C(C1(C)CCC(C)(C=C)OC3C(C(C(CO3)O)O)O)CCC=C2C)C)OC4C(C(C(C(O4)C)OC5C(C(C(C(O5)C)O)O)O)O)OC6C(C(C(C(O6)C)O)O)O |
| SMILES (Isomeric) | CC1CC(C2(C(C1(C)CCC(C)(C=C)OC3C(C(C(CO3)O)O)O)CCC=C2C)C)OC4C(C(C(C(O4)C)OC5C(C(C(C(O5)C)O)O)O)O)OC6C(C(C(C(O6)C)O)O)O |
| InChI | InChI=1S/C43H72O18/c1-10-41(7,61-37-31(50)28(47)23(44)17-54-37)14-15-42(8)19(3)16-25(43(9)18(2)12-11-13-24(42)43)58-40-36(60-39-33(52)30(49)27(46)21(5)56-39)34(53)35(22(6)57-40)59-38-32(51)29(48)26(45)20(4)55-38/h10,12,19-40,44-53H,1,11,13-17H2,2-9H3 |
| InChI Key | HTDSQTFOZGOGLV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C43H72O18 |
| Molecular Weight | 877.00 g/mol |
| Exact Mass | 876.47186544 g/mol |
| Topological Polar Surface Area (TPSA) | 276.00 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.17% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.00% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.75% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.25% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.83% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.30% | 98.95% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.95% | 97.36% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.81% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.72% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.23% | 94.73% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.79% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.67% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.36% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.46% | 91.07% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.32% | 90.24% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.29% | 95.93% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.32% | 97.14% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.27% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hymenophyllum nephrophyllum |
| PubChem | 162985731 |
| LOTUS | LTS0055601 |
| wikiData | Q105033382 |