[2-Methoxy-2-methyl-1-[10,11,20-trihydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate
| Internal ID | b390ed27-84b6-471e-a1cd-21f03239d697 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | [2-methoxy-2-methyl-1-[10,11,20-trihydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate |
| SMILES (Canonical) | CC1CC(OC2(C1C3(CCC45CC46C(CCC5C3(C2O)C)C(C(CC6O)OC7C(C(C(CO7)O)O)O)(C)C)C)O)C(C(C)(C)OC)OC(=O)C |
| SMILES (Isomeric) | CC1CC(OC2(C1C3(CCC45CC46C(CCC5C3(C2O)C)C(C(CC6O)OC7C(C(C(CO7)O)O)O)(C)C)C)O)C(C(C)(C)OC)OC(=O)C |
| InChI | InChI=1S/C38H62O12/c1-18-14-21(29(48-19(2)39)33(5,6)46-9)50-38(45)28(18)34(7)12-13-36-17-37(36)22(10-11-23(36)35(34,8)31(38)44)32(3,4)25(15-24(37)41)49-30-27(43)26(42)20(40)16-47-30/h18,20-31,40-45H,10-17H2,1-9H3 |
| InChI Key | CDVLNJHGGOFODI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C38H62O12 |
| Molecular Weight | 710.90 g/mol |
| Exact Mass | 710.42412741 g/mol |
| Topological Polar Surface Area (TPSA) | 185.00 Ų |
| XlogP | 2.70 |
| Atomic LogP (AlogP) | 2.27 |
| H-Bond Acceptor | 12 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 6 |
| There are no found synonyms. |
![2D Structure of [2-Methoxy-2-methyl-1-[10,11,20-trihydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/4b9106b0-7fcd-11ee-8cff-f5e33aa918ed.jpg "2D Structure of [2-Methoxy-2-methyl-1-[10,11,20-trihydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7468 | 74.68% |
| Caco-2 | - | 0.8693 | 86.93% |
| Blood Brain Barrier | - | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.8000 | 80.00% |
| Subcellular localzation | Mitochondria | 0.7008 | 70.08% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8563 | 85.63% |
| OATP1B3 inhibitior | + | 0.9208 | 92.08% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | - | 0.7654 | 76.54% |
| P-glycoprotein inhibitior | + | 0.7876 | 78.76% |
| P-glycoprotein substrate | + | 0.7178 | 71.78% |
| CYP3A4 substrate | + | 0.7450 | 74.50% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8743 | 87.43% |
| CYP3A4 inhibition | - | 0.8800 | 88.00% |
| CYP2C9 inhibition | - | 0.7862 | 78.62% |
| CYP2C19 inhibition | - | 0.8614 | 86.14% |
| CYP2D6 inhibition | - | 0.9453 | 94.53% |
| CYP1A2 inhibition | - | 0.8436 | 84.36% |
| CYP2C8 inhibition | + | 0.7559 | 75.59% |
| CYP inhibitory promiscuity | - | 0.9782 | 97.82% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9900 | 99.00% |
| Carcinogenicity (trinary) | Non-required | 0.6793 | 67.93% |
| Eye corrosion | - | 0.9891 | 98.91% |
| Eye irritation | - | 0.9101 | 91.01% |
| Skin irritation | - | 0.6844 | 68.44% |
| Skin corrosion | - | 0.9390 | 93.90% |
| Ames mutagenesis | - | 0.5000 | 50.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6890 | 68.90% |
| Micronuclear | - | 0.7800 | 78.00% |
| Hepatotoxicity | - | 0.6716 | 67.16% |
| skin sensitisation | - | 0.8883 | 88.83% |
| Respiratory toxicity | - | 0.5000 | 50.00% |
| Reproductive toxicity | + | 0.7889 | 78.89% |
| Mitochondrial toxicity | + | 0.7000 | 70.00% |
| Nephrotoxicity | - | 0.7637 | 76.37% |
| Acute Oral Toxicity (c) | III | 0.3391 | 33.91% |
| Estrogen receptor binding | + | 0.6287 | 62.87% |
| Androgen receptor binding | + | 0.7325 | 73.25% |
| Thyroid receptor binding | - | 0.5620 | 56.20% |
| Glucocorticoid receptor binding | + | 0.6637 | 66.37% |
| Aromatase binding | + | 0.6999 | 69.99% |
| PPAR gamma | + | 0.6842 | 68.42% |
| Honey bee toxicity | - | 0.6073 | 60.73% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | + | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.8669 | 86.69% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.52% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.33% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.07% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.87% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.62% | 85.14% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 95.19% | 95.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.00% | 98.95% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 93.88% | 98.75% |
| CHEMBL204 | P00734 | Thrombin | 92.89% | 96.01% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.60% | 97.14% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.10% | 96.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.83% | 82.69% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.24% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.12% | 91.19% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.32% | 89.50% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.83% | 92.86% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 87.16% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.83% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.69% | 89.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.44% | 95.71% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.29% | 96.61% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.47% | 91.03% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.15% | 97.28% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.75% | 97.53% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.66% | 87.67% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.48% | 91.07% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.43% | 94.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.32% | 91.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.94% | 92.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.80% | 94.45% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.63% | 95.36% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.61% | 92.62% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.54% | 92.88% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.26% | 100.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.97% | 97.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.09% | 96.90% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.02% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.00% | 94.00% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 80.67% | 95.27% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.50% | 100.00% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.38% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actaea simplex |
| PubChem | 85286595 |
| LOTUS | LTS0028398 |
| wikiData | Q104955241 |