4b,8,8-Trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2,5-diol
| Internal ID | bb622292-5f0b-4b65-9e4b-e1fec9d8cd63 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2,5-diol |
| SMILES (Canonical) | CC1(CCC(C2(C1CCC3=C2C=CC(=C3)O)C)O)C |
| SMILES (Isomeric) | CC1(CCC(C2(C1CCC3=C2C=CC(=C3)O)C)O)C |
| InChI | InChI=1S/C17H24O2/c1-16(2)9-8-15(19)17(3)13-6-5-12(18)10-11(13)4-7-14(16)17/h5-6,10,14-15,18-19H,4,7-9H2,1-3H3 |
| InChI Key | MEMJJLCEZJUTHW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.63% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.12% | 98.35% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.84% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.73% | 100.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.99% | 91.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.16% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.50% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.97% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.84% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.09% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.63% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.29% | 86.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.85% | 95.89% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.81% | 93.40% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.75% | 89.05% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.73% | 90.71% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.64% | 90.24% |
| CHEMBL236 | P41143 | Delta opioid receptor | 80.11% | 99.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taiwania cryptomerioides |
| PubChem | 85345087 |
| LOTUS | LTS0087178 |
| wikiData | Q105162295 |