4b,8,8-Trimethyl-2-propan-2-yl-5,8a,9,10-tetrahydrophenanthren-3-ol
Internal ID | 75d379d0-df20-46da-b02a-284038abc214 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 4b,8,8-trimethyl-2-propan-2-yl-5,8a,9,10-tetrahydrophenanthren-3-ol |
SMILES (Canonical) | CC(C)C1=C(C=C2C(=C1)CCC3C2(CC=CC3(C)C)C)O |
SMILES (Isomeric) | CC(C)C1=C(C=C2C(=C1)CCC3C2(CC=CC3(C)C)C)O |
InChI | InChI=1S/C20H28O/c1-13(2)15-11-14-7-8-18-19(3,4)9-6-10-20(18,5)16(14)12-17(15)21/h6,9,11-13,18,21H,7-8,10H2,1-5H3 |
InChI Key | KNFQFMAXIWUYSL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O |
Molecular Weight | 284.40 g/mol |
Exact Mass | 284.214015512 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 6.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.61% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.43% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 90.02% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.02% | 83.82% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.14% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.04% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.64% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.16% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.68% | 93.40% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.54% | 90.71% |
CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 84.89% | 93.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.78% | 97.09% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.50% | 91.03% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.27% | 96.38% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.17% | 94.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.07% | 92.94% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.96% | 91.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.14% | 95.56% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 82.11% | 96.76% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.43% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cryptomeria japonica |
PubChem | 14038045 |
LOTUS | LTS0077758 |
wikiData | Q105143399 |