(3,4,6,9,11,13,14-heptahydroxy-2-methoxy-3,7,10-trimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadecan-12-yl) 1H-pyrrole-2-carboxylate
Internal ID | 520c28c4-0a10-42ac-9e5c-1d66c39c7a84 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (3,4,6,9,11,13,14-heptahydroxy-2-methoxy-3,7,10-trimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadecan-12-yl) 1H-pyrrole-2-carboxylate |
SMILES (Canonical) | CC(C)C1(C(C2(C3(CC4(C1(C2(C5(C3(CC(C(C5OC)(C)O)O)O)O4)O)C)O)C)O)OC(=O)C6=CC=CN6)O |
SMILES (Isomeric) | CC(C)C1(C(C2(C3(CC4(C1(C2(C5(C3(CC(C(C5OC)(C)O)O)O)O4)O)C)O)C)O)OC(=O)C6=CC=CN6)O |
InChI | InChI=1S/C26H37NO11/c1-12(2)23(33)17(37-15(29)13-8-7-9-27-13)24(34)18(3)11-22(32)20(23,5)26(24,35)25(38-22)16(36-6)19(4,30)14(28)10-21(18,25)31/h7-9,12,14,16-17,27-28,30-35H,10-11H2,1-6H3 |
InChI Key | HHMHQQMOGMCRFI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H37NO11 |
Molecular Weight | 539.60 g/mol |
Exact Mass | 539.23666100 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | -2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.65% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.84% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.33% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.15% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.89% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.93% | 95.56% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.30% | 85.30% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.17% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.10% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.89% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.52% | 89.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.77% | 97.28% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.23% | 91.07% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.78% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.65% | 97.79% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.64% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ryania speciosa |
PubChem | 162955605 |
LOTUS | LTS0232218 |
wikiData | Q105028375 |