(8-acetyloxy-4,9-dihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbutanoate
Internal ID | 538545cc-89eb-4b11-a2ed-f21f3b0223bb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones |
IUPAC Name | (8-acetyloxy-4,9-dihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1CC(C2(C1C(C(C3C(C2O)C(=C)C(=O)O3)O)C)C)OC(=O)C |
SMILES (Isomeric) | CCC(C)C(=O)OC1CC(C2(C1C(C(C3C(C2O)C(=C)C(=O)O3)O)C)C)OC(=O)C |
InChI | InChI=1S/C22H32O8/c1-7-9(2)20(26)29-13-8-14(28-12(5)23)22(6)16(13)11(4)17(24)18-15(19(22)25)10(3)21(27)30-18/h9,11,13-19,24-25H,3,7-8H2,1-2,4-6H3 |
InChI Key | WZXOOHRYBWQIBX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H32O8 |
Molecular Weight | 424.50 g/mol |
Exact Mass | 424.20971797 g/mol |
Topological Polar Surface Area (TPSA) | 119.00 Ų |
XlogP | 2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.77% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.75% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.63% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.55% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.53% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.58% | 85.14% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 94.42% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 91.99% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.52% | 86.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.60% | 96.47% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.12% | 89.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.75% | 89.00% |
CHEMBL299 | P17252 | Protein kinase C alpha | 84.55% | 98.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.29% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.96% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.52% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.75% | 95.89% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.71% | 98.75% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.56% | 96.77% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.40% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gaillardia pulchella |
PubChem | 162993385 |
LOTUS | LTS0137396 |
wikiData | Q105323622 |