5,7-dihydroxy-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one
Internal ID | 3c1c5e33-a997-43c3-8c7d-0e6fcfce3cfd |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
IUPAC Name | 5,7-dihydroxy-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | C1=CC=C(C(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=CC=C(C(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)30-13-4-2-1-3-10(13)14-7-12(25)17-11(24)5-9(23)6-15(17)29-14/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
InChI Key | AZRVQJNRDWOJQR-QNDFHXLGSA-N |
Popularity | 2 references in papers |
Molecular Formula | C21H20O10 |
Molecular Weight | 432.40 g/mol |
Exact Mass | 432.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
![2D Structure of 5,7-dihydroxy-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one 2D Structure of 5,7-dihydroxy-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/4b0524c0-8649-11ee-b684-c16d682ca564.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.01% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.57% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.74% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.27% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 93.24% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.14% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.09% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.80% | 96.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.25% | 99.17% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.87% | 95.83% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.51% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.90% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.95% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Colebrookea oppositifolia |
Scutellaria amabilis |
PubChem | 10670361 |
LOTUS | LTS0191864 |
wikiData | Q104921900 |