(4aS,9S,10aS)-8-ethyl-1,1,4a,7-tetramethyl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol
Internal ID | 47ca57f3-294a-4f9d-b26f-e605f3f64f7f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (4aS,9S,10aS)-8-ethyl-1,1,4a,7-tetramethyl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol |
SMILES (Canonical) | CCC1=C(C=CC2=C1C(CC3C2(CCCC3(C)C)C)O)C |
SMILES (Isomeric) | CCC1=C(C=CC2=C1[C@H](C[C@@H]3[C@@]2(CCCC3(C)C)C)O)C |
InChI | InChI=1S/C20H30O/c1-6-14-13(2)8-9-15-18(14)16(21)12-17-19(3,4)10-7-11-20(15,17)5/h8-9,16-17,21H,6-7,10-12H2,1-5H3/t16-,17-,20+/m0/s1 |
InChI Key | QIUJMGGQTRHESK-ABSDTBQOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H30O |
Molecular Weight | 286.50 g/mol |
Exact Mass | 286.229665576 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 5.80 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.93% | 96.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.51% | 89.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.57% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.13% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.81% | 91.11% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.63% | 96.38% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.72% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.23% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 84.79% | 98.95% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.38% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.08% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.98% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.32% | 95.56% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.99% | 82.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vellozia declinans |
PubChem | 101637191 |
LOTUS | LTS0125039 |
wikiData | Q105221793 |