(4aS,7R)-7-(1-hydroxy-2-methylpropan-2-yl)-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one
Internal ID | e62794ac-f303-4343-b2af-9839ac111f13 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
IUPAC Name | (4aS,7R)-7-(1-hydroxy-2-methylpropan-2-yl)-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
SMILES (Canonical) | CC1=C2CC(CCC2(CCC1=O)C)C(C)(C)CO |
SMILES (Isomeric) | CC1=C2C[C@@H](CC[C@]2(CCC1=O)C)C(C)(C)CO |
InChI | InChI=1S/C16H26O2/c1-11-13-9-12(15(2,3)10-17)5-7-16(13,4)8-6-14(11)18/h12,17H,5-10H2,1-4H3/t12-,16+/m1/s1 |
InChI Key | FBUATBCHRJONKT-WBMJQRKESA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H26O2 |
Molecular Weight | 250.38 g/mol |
Exact Mass | 250.193280068 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.47% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.60% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.90% | 96.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.38% | 90.93% |
CHEMBL2581 | P07339 | Cathepsin D | 90.21% | 98.95% |
CHEMBL1871 | P10275 | Androgen Receptor | 89.70% | 96.43% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.08% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.60% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.88% | 94.75% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.55% | 97.05% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.06% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.94% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.39% | 93.04% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.14% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia oxyphylla |
PubChem | 162866948 |
LOTUS | LTS0249914 |
wikiData | Q104992943 |