(4aS,5R,8aR,9aR)-9a-hydroxy-3,4a,5-trimethyl-4,5,8a,9-tetrahydrobenzo[f][1]benzofuran-2,6-dione
| Internal ID | 5101a1d1-3b7c-47de-a037-be7b97efc4c0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | (4aS,5R,8aR,9aR)-9a-hydroxy-3,4a,5-trimethyl-4,5,8a,9-tetrahydrobenzo[f][1]benzofuran-2,6-dione |
| SMILES (Canonical) | CC1C(=O)C=CC2C1(CC3=C(C(=O)OC3(C2)O)C)C |
| SMILES (Isomeric) | C[C@H]1C(=O)C=C[C@@H]2[C@@]1(CC3=C(C(=O)O[C@@]3(C2)O)C)C |
| InChI | InChI=1S/C15H18O4/c1-8-11-7-14(3)9(2)12(16)5-4-10(14)6-15(11,18)19-13(8)17/h4-5,9-10,18H,6-7H2,1-3H3/t9-,10-,14+,15+/m0/s1 |
| InChI Key | AUTCBAXZIRBJNE-NBLIUIFLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
![2D Structure of (4aS,5R,8aR,9aR)-9a-hydroxy-3,4a,5-trimethyl-4,5,8a,9-tetrahydrobenzo[f][1]benzofuran-2,6-dione](https://plantaedb.com/storage/docs/compounds/2023/11/4as5r8ar9ar-9a-hydroxy-34a5-trimethyl-458a9-tetrahydrobenzof1benzofuran-26-dione.jpg "2D Structure of (4aS,5R,8aR,9aR)-9a-hydroxy-3,4a,5-trimethyl-4,5,8a,9-tetrahydrobenzo[f][1]benzofuran-2,6-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.01% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.43% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.36% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.65% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.71% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.59% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.56% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.10% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.28% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.81% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ligularia fischeri |
| Senecio flavus |
| Senecio nemorensis |
| PubChem | 10106762 |
| LOTUS | LTS0080259 |
| wikiData | Q104919124 |