(4aS)-4a-hydroxy-1,4-dimethyl-2,3-dihydrocyclopenta[b]anthracene-5,10-dione
| Internal ID | 2dda09c2-e7fb-4f57-9a65-6857c9b7ccdc |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | (4aS)-4a-hydroxy-1,4-dimethyl-2,3-dihydrocyclopenta[b]anthracene-5,10-dione |
| SMILES (Canonical) | CC1=C2C=C3C(=O)C4=CC=CC=C4C(=O)C3(C(=C2CC1)C)O |
| SMILES (Isomeric) | CC1=C2C=C3C(=O)C4=CC=CC=C4C(=O)[C@@]3(C(=C2CC1)C)O |
| InChI | InChI=1S/C19H16O3/c1-10-7-8-12-11(2)19(22)16(9-15(10)12)17(20)13-5-3-4-6-14(13)18(19)21/h3-6,9,22H,7-8H2,1-2H3/t19-/m0/s1 |
| InChI Key | CPNACVBJSMUJDD-IBGZPJMESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
![2D Structure of (4aS)-4a-hydroxy-1,4-dimethyl-2,3-dihydrocyclopenta[b]anthracene-5,10-dione](https://plantaedb.com/storage/docs/compounds/2023/11/4as-4a-hydroxy-14-dimethyl-23-dihydrocyclopentabanthracene-510-dione.jpg "2D Structure of (4aS)-4a-hydroxy-1,4-dimethyl-2,3-dihydrocyclopenta[b]anthracene-5,10-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.92% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.57% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.09% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.18% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.74% | 99.23% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.68% | 96.67% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.21% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.16% | 91.49% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.99% | 90.17% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.74% | 92.97% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.42% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stereospermum acuminatissimum |
| Stereospermum chelonoides |
| PubChem | 101260667 |
| LOTUS | LTS0072327 |
| wikiData | Q104967652 |