(4aR,8R,8aS)-8-(piperidin-1-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline
Internal ID | e33d3836-6dc7-41d1-b2ac-f98cc6b267e9 |
Taxonomy | Organoheterocyclic compounds > Quinolidines |
IUPAC Name | (4aR,8R,8aS)-8-(piperidin-1-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
SMILES (Canonical) | C1CCN(CC1)CC2CCCC3C2NCCC3 |
SMILES (Isomeric) | C1CCN(CC1)C[C@H]2CCC[C@H]3[C@@H]2NCCC3 |
InChI | InChI=1S/C15H28N2/c1-2-10-17(11-3-1)12-14-7-4-6-13-8-5-9-16-15(13)14/h13-16H,1-12H2/t13-,14-,15+/m1/s1 |
InChI Key | SVDDLFTVUZEYQM-KFWWJZLASA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H28N2 |
Molecular Weight | 236.40 g/mol |
Exact Mass | 236.225248902 g/mol |
Topological Polar Surface Area (TPSA) | 15.30 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of (4aR,8R,8aS)-8-(piperidin-1-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline 2D Structure of (4aR,8R,8aS)-8-(piperidin-1-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline](https://plantaedb.com/storage/docs/compounds/2023/11/4ar8r8as-8-piperidin-1-ylmethyl-12344a56788a-decahydroquinoline.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.43% | 97.25% |
CHEMBL228 | P31645 | Serotonin transporter | 96.27% | 95.51% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.32% | 98.10% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.91% | 97.09% |
CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 91.31% | 97.15% |
CHEMBL238 | Q01959 | Dopamine transporter | 89.68% | 95.88% |
CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 89.17% | 93.90% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 88.94% | 99.29% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 88.46% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.40% | 96.09% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 86.66% | 91.76% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.12% | 95.50% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 86.10% | 90.24% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.65% | 92.94% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 85.35% | 94.78% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.25% | 94.45% |
CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 84.93% | 98.77% |
CHEMBL2581 | P07339 | Cathepsin D | 84.81% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.71% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.57% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.01% | 96.21% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.93% | 95.83% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.67% | 99.18% |
CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 82.26% | 98.33% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.21% | 95.58% |
CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 82.06% | 95.61% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 82.03% | 80.71% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 81.62% | 95.34% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 81.43% | 98.99% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.74% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nitraria sibirica |
PubChem | 163047261 |
LOTUS | LTS0235879 |
wikiData | Q105261856 |