[2-[(3S,4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-3-yl]-2-hydroxyethyl] acetate
Internal ID | 77c7c7d9-1929-4252-9f4d-a5575012a02e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [2-[(3S,4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-3-yl]-2-hydroxyethyl] acetate |
SMILES (Canonical) | CC(=O)OCC(C1(CC(=O)C2C3(CCCC(C3CCC2(O1)C)(C)C)C)C)O |
SMILES (Isomeric) | CC(=O)OCC([C@@]1(CC(=O)[C@@H]2[C@]3(CCCC([C@@H]3CC[C@]2(O1)C)(C)C)C)C)O |
InChI | InChI=1S/C22H36O5/c1-14(23)26-13-17(25)22(6)12-15(24)18-20(4)10-7-9-19(2,3)16(20)8-11-21(18,5)27-22/h16-18,25H,7-13H2,1-6H3/t16-,17?,18+,20-,21+,22-/m0/s1 |
InChI Key | STLPKKQTDQJLCC-AGJRCRGTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H36O5 |
Molecular Weight | 380.50 g/mol |
Exact Mass | 380.25627424 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.65% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.69% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.48% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.84% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.79% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.64% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.48% | 93.04% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.28% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.96% | 86.33% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.56% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.36% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.04% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.62% | 92.62% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.49% | 91.07% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.27% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.11% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.10% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.05% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.89% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Grindelia tarapacana |
PubChem | 15226676 |
LOTUS | LTS0137668 |
wikiData | Q105260365 |