[5-[3-Hydroxy-6-methyl-5-(2-methylpropanoyloxy)-4-(3-phenylprop-2-enoyloxy)oxan-2-yl]oxy-6-methyl-2-[[7,25,26-trihydroxy-24-(hydroxymethyl)-5-methyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 2-methylbutanoate
Internal ID | 4052e603-e6b0-47fc-9dc7-46ace9cc2ea5 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [5-[3-hydroxy-6-methyl-5-(2-methylpropanoyloxy)-4-(3-phenylprop-2-enoyloxy)oxan-2-yl]oxy-6-methyl-2-[[7,25,26-trihydroxy-24-(hydroxymethyl)-5-methyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 2-methylbutanoate |
SMILES (Canonical) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(C(OC2OC3C(C(C(OC3O1)CO)O)O)C)OC4C(C(C(C(O4)C)OC5C(C(C(C(O5)C)OC(=O)C(C)C)OC(=O)C=CC6=CC=CC=C6)O)OC7C(C(C(C(O7)C)O)O)O)OC(=O)C(C)CC)O |
SMILES (Isomeric) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(C(OC2OC3C(C(C(OC3O1)CO)O)O)C)OC4C(C(C(C(O4)C)OC5C(C(C(C(O5)C)OC(=O)C(C)C)OC(=O)C=CC6=CC=CC=C6)O)OC7C(C(C(C(O7)C)O)O)O)OC(=O)C(C)CC)O |
InChI | InChI=1S/C64H100O26/c1-10-12-19-26-39-27-22-16-14-13-15-17-23-28-41(66)84-55-48(73)50(35(7)79-62(55)89-54-46(71)44(69)40(31-65)82-63(54)81-39)87-64-57(86-59(76)33(5)11-2)56(90-60-47(72)45(70)43(68)34(6)77-60)52(37(9)80-64)88-61-49(74)53(51(36(8)78-61)85-58(75)32(3)4)83-42(67)30-29-38-24-20-18-21-25-38/h18,20-21,24-25,29-30,32-37,39-40,43-57,60-65,68-74H,10-17,19,22-23,26-28,31H2,1-9H3 |
InChI Key | DUXDYOZDCAEBFF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C64H100O26 |
Molecular Weight | 1285.50 g/mol |
Exact Mass | 1284.65028329 g/mol |
Topological Polar Surface Area (TPSA) | 359.00 Ų |
XlogP | 6.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.52% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.86% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.48% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.65% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.21% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.90% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.06% | 89.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.04% | 93.56% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.86% | 83.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.42% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.83% | 92.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.20% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.09% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.90% | 96.47% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.91% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.16% | 94.73% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.32% | 96.61% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.19% | 91.71% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.96% | 93.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.95% | 96.37% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.69% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 81.86% | 97.50% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 81.11% | 96.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.45% | 99.23% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.24% | 92.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.12% | 94.08% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.12% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea batatas |
PubChem | 74818141 |
LOTUS | LTS0194702 |
wikiData | Q104989587 |