(2S)-2,3,3,9-tetramethyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furo[3,2-c]chromen-4-one
| Internal ID | c4c94bc8-a6e9-41ba-ad4b-a96d55644f78 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | (2S)-2,3,3,9-tetramethyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furo[3,2-c]chromen-4-one |
| SMILES (Canonical) | CC1C(C2=C(O1)C3=C(C=CC(=C3C)OC4C(C(C(C(O4)CO)O)O)O)OC2=O)(C)C |
| SMILES (Isomeric) | C[C@H]1C(C2=C(O1)C3=C(C=CC(=C3C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC2=O)(C)C |
| InChI | InChI=1S/C21H26O9/c1-8-10(29-20-17(25)16(24)15(23)12(7-22)30-20)5-6-11-13(8)18-14(19(26)28-11)21(3,4)9(2)27-18/h5-6,9,12,15-17,20,22-25H,7H2,1-4H3/t9-,12+,15+,16-,17+,20+/m0/s1 |
| InChI Key | DJIFKQZSWFBCCE-NRQWSEGZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15768240 g/mol |
| Topological Polar Surface Area (TPSA) | 135.00 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
![2D Structure of (2S)-2,3,3,9-tetramethyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furo[3,2-c]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/4a40f1e0-860e-11ee-bb45-679e049e42e5.jpg "2D Structure of (2S)-2,3,3,9-tetramethyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furo[3,2-c]chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.28% | 94.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 93.47% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.72% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.00% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.81% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.17% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.02% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.53% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.62% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.51% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.68% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.90% | 95.89% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.37% | 86.92% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.18% | 96.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.18% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glaucidium palmatum |
| PubChem | 163023989 |
| LOTUS | LTS0122865 |
| wikiData | Q104982253 |