[(2R,3S,4R,5S,6S)-4-acetyloxy-6-(acetyloxymethyl)-2-[[(3R,4S,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-5-[3-hydroxy-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]oxyoxan-3-yl] 2,3-dihydroxybenzoate
Internal ID | 9c7cd44c-4645-48f5-a249-d4bf4a4912fc |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Pentacarboxylic acids and derivatives |
IUPAC Name | [(2R,3S,4R,5S,6S)-4-acetyloxy-6-(acetyloxymethyl)-2-[[(3R,4S,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-5-[3-hydroxy-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]oxyoxan-3-yl] 2,3-dihydroxybenzoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2C(C3CCOC(=O)C3=CO2)C=C)OC(=O)C4=C(C(=CC=C4)O)O)OC(=O)C)OC(=O)C5=C(C(=CC=C5)O)OC6C(C(C(C(O6)CO)O)O)O |
SMILES (Isomeric) | CC(=O)OC[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)O[C@@H]2[C@H]([C@@H]3CCOC(=O)C3=CO2)C=C)OC(=O)C4=C(C(=CC=C4)O)O)OC(=O)C)OC(=O)C5=C(C(=CC=C5)O)O[C@@H]6[C@H]([C@@H]([C@H]([C@@H](O6)CO)O)O)O |
InChI | InChI=1S/C40H44O22/c1-4-18-19-11-12-53-35(50)22(19)14-55-38(18)62-40-34(60-36(51)20-7-5-9-23(44)27(20)46)33(56-17(3)43)32(26(58-40)15-54-16(2)42)59-37(52)21-8-6-10-24(45)31(21)61-39-30(49)29(48)28(47)25(13-41)57-39/h4-10,14,18-19,25-26,28-30,32-34,38-41,44-49H,1,11-13,15H2,2-3H3/t18-,19-,25-,26-,28-,29+,30-,32-,33+,34-,38+,39+,40+/m0/s1 |
InChI Key | PCQHAARAQYTSDQ-OPCCJVHKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H44O22 |
Molecular Weight | 876.80 g/mol |
Exact Mass | 876.23242303 g/mol |
Topological Polar Surface Area (TPSA) | 319.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.98% | 91.11% |
CHEMBL220 | P22303 | Acetylcholinesterase | 97.96% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 97.22% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.00% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.25% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.56% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.26% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.57% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.52% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.28% | 94.45% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.70% | 94.80% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.36% | 95.17% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.93% | 91.24% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.38% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.92% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.68% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.38% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.67% | 97.25% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.65% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.57% | 83.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.43% | 94.75% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.82% | 92.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.54% | 95.83% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.15% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gentiana tibetica |
PubChem | 163195362 |
LOTUS | LTS0226257 |
wikiData | Q105205926 |