[(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,23-dihydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-22-yl] hexanoate
Internal ID | 8a7c9e94-4d83-42f5-9ecc-fc5af8856b77 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,23-dihydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-22-yl] hexanoate |
SMILES (Canonical) | CCCCCC(=O)OC1CC(CC2C13C(CC4(C2(CCC5C4(CCC6C5(CCC(C6(C)C)OC7C(C(C(CO7)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(CO9)O)O)O)O)OC1C(C(C(C(O1)CO)O)O)O)C)C)OC3O)C)O)(C)C |
SMILES (Isomeric) | CCCCCC(=O)O[C@H]1CC(C[C@@H]2[C@@]13[C@@H](C[C@@]4([C@@]2(CC[C@H]5[C@]4(CC[C@@H]6[C@@]5(CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@H](CO7)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C)C)O[C@@H]3O)C)O)(C)C |
InChI | InChI=1S/C58H96O24/c1-9-10-11-12-36(63)78-35-21-52(2,3)19-32-57-18-14-31-54(6)16-15-34(53(4,5)30(54)13-17-55(31,7)56(57,8)20-33(62)58(32,35)51(72)82-57)79-49-45(81-48-44(71)41(68)38(65)27(22-59)75-48)40(67)29(25-74-49)77-50-46(42(69)39(66)28(23-60)76-50)80-47-43(70)37(64)26(61)24-73-47/h26-35,37-51,59-62,64-72H,9-25H2,1-8H3/t26-,27-,28-,29+,30+,31-,32+,33-,34+,35+,37+,38-,39-,40+,41+,42+,43-,44-,45-,46-,47+,48+,49+,50+,51+,54+,55-,56+,57+,58-/m1/s1 |
InChI Key | QFCPRKADRIVFOU-DEHVKKEISA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H96O24 |
Molecular Weight | 1177.40 g/mol |
Exact Mass | 1176.62915392 g/mol |
Topological Polar Surface Area (TPSA) | 372.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of [(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,23-dihydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-22-yl] hexanoate 2D Structure of [(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,23-dihydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-22-yl] hexanoate](https://plantaedb.com/storage/docs/compounds/2023/11/493b4c00-8724-11ee-80d8-19cea24e881f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.38% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.60% | 91.11% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 96.62% | 91.24% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.22% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 95.88% | 92.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.80% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.30% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.30% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.04% | 99.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.81% | 96.21% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 91.48% | 97.79% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 91.40% | 95.36% |
CHEMBL299 | P17252 | Protein kinase C alpha | 90.90% | 98.03% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 90.87% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.70% | 96.43% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 90.37% | 82.50% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.25% | 92.98% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.70% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.43% | 95.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.70% | 94.33% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.31% | 95.38% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.10% | 92.88% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.80% | 97.29% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.72% | 92.86% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.85% | 100.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.58% | 95.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.39% | 92.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.39% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.27% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.13% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.61% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.56% | 97.36% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.28% | 91.81% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.80% | 95.89% |
CHEMBL233 | P35372 | Mu opioid receptor | 82.71% | 97.93% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.47% | 97.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.84% | 97.14% |
CHEMBL5028 | O14672 | ADAM10 | 80.10% | 97.50% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.07% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lysimachia capillipes |
PubChem | 11506357 |
LOTUS | LTS0091902 |
wikiData | Q105219484 |