2-[[(E,2S,3R,6S)-2,3-dimethyl-6-[(3S,5S,6S,8S,9R,10S,13R,14S,15R,17R)-6,8,15-trihydroxy-10,13-dimethyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]hept-4-enoyl]amino]ethanesulfonic acid
| Internal ID | 3459aca4-2e7b-4f17-83a0-2b311ca7c8cc |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Ergostane steroids |
| IUPAC Name | 2-[[(E,2S,3R,6S)-2,3-dimethyl-6-[(3S,5S,6S,8S,9R,10S,13R,14S,15R,17R)-6,8,15-trihydroxy-10,13-dimethyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]hept-4-enoyl]amino]ethanesulfonic acid |
| SMILES (Canonical) | CC(C=CC(C)C(C)C(=O)NCCS(=O)(=O)O)C1CC(C2C1(CCC3C2(CC(C4C3(CCC(C4)OC5C(C(C(CO5)O)O)O)C)O)O)C)O |
| SMILES (Isomeric) | C[C@@H](/C=C/[C@@H](C)[C@H](C)C(=O)NCCS(=O)(=O)O)[C@H]1C[C@H]([C@@H]2[C@@]1(CC[C@H]3[C@]2(C[C@@H]([C@@H]4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)C)O)O)C)O |
| InChI | InChI=1S/C35H59NO12S/c1-18(20(3)31(42)36-12-13-49(44,45)46)6-7-19(2)22-15-24(37)30-34(22,5)11-9-27-33(4)10-8-21(14-23(33)25(38)16-35(27,30)43)48-32-29(41)28(40)26(39)17-47-32/h6-7,18-30,32,37-41,43H,8-17H2,1-5H3,(H,36,42)(H,44,45,46)/b7-6+/t18-,19+,20+,21+,22-,23-,24-,25+,26-,27-,28+,29-,30-,32+,33+,34-,35+/m1/s1 |
| InChI Key | ZNIBBCNKCIEYFM-TTYITWJESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H59NO12S |
| Molecular Weight | 717.90 g/mol |
| Exact Mass | 717.37579749 g/mol |
| Topological Polar Surface Area (TPSA) | 232.00 Ų |
| XlogP | 0.80 |
| Atomic LogP (AlogP) | 0.99 |
| H-Bond Acceptor | 11 |
| H-Bond Donor | 8 |
| Rotatable Bonds | 10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6092 | 60.92% |
| Caco-2 | - | 0.8704 | 87.04% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.3670 | 36.70% |
| OATP2B1 inhibitior | - | 0.7217 | 72.17% |
| OATP1B1 inhibitior | + | 0.8485 | 84.85% |
| OATP1B3 inhibitior | + | 0.9248 | 92.48% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.7249 | 72.49% |
| P-glycoprotein inhibitior | + | 0.7173 | 71.73% |
| P-glycoprotein substrate | + | 0.7216 | 72.16% |
| CYP3A4 substrate | + | 0.7411 | 74.11% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8691 | 86.91% |
| CYP3A4 inhibition | - | 0.7420 | 74.20% |
| CYP2C9 inhibition | - | 0.7823 | 78.23% |
| CYP2C19 inhibition | - | 0.7584 | 75.84% |
| CYP2D6 inhibition | - | 0.8732 | 87.32% |
| CYP1A2 inhibition | - | 0.7698 | 76.98% |
| CYP2C8 inhibition | + | 0.6696 | 66.96% |
| CYP inhibitory promiscuity | - | 0.8332 | 83.32% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.5000 | 50.00% |
| Carcinogenicity (trinary) | Non-required | 0.5799 | 57.99% |
| Eye corrosion | - | 0.9768 | 97.68% |
| Eye irritation | - | 0.9201 | 92.01% |
| Skin irritation | - | 0.7611 | 76.11% |
| Skin corrosion | - | 0.9109 | 91.09% |
| Ames mutagenesis | - | 0.5300 | 53.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6542 | 65.42% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | - | 0.5587 | 55.87% |
| skin sensitisation | - | 0.8419 | 84.19% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.8994 | 89.94% |
| Acute Oral Toxicity (c) | III | 0.6373 | 63.73% |
| Estrogen receptor binding | + | 0.7402 | 74.02% |
| Androgen receptor binding | + | 0.6783 | 67.83% |
| Thyroid receptor binding | - | 0.6074 | 60.74% |
| Glucocorticoid receptor binding | + | 0.6639 | 66.39% |
| Aromatase binding | + | 0.6457 | 64.57% |
| PPAR gamma | + | 0.6939 | 69.39% |
| Honey bee toxicity | - | 0.6826 | 68.26% |
| Biodegradation | - | 0.6500 | 65.00% |
| Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.9453 | 94.53% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.36% | 97.25% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 99.19% | 85.31% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 98.71% | 95.93% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.28% | 91.11% |
| CHEMBL204 | P00734 | Thrombin | 98.02% | 96.01% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.88% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.86% | 98.95% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.11% | 96.38% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.95% | 96.77% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 92.04% | 89.67% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.69% | 95.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.47% | 97.09% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.45% | 92.98% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.38% | 98.59% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.25% | 82.69% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.91% | 97.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.88% | 91.19% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.88% | 100.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.05% | 98.75% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.92% | 95.58% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.83% | 95.89% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.55% | 96.21% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 88.50% | 95.83% |
| CHEMBL5028 | O14672 | ADAM10 | 88.22% | 97.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.99% | 94.45% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 87.95% | 97.50% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 87.71% | 88.81% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.21% | 91.07% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 86.09% | 96.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.80% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.79% | 89.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.61% | 91.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.53% | 100.00% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.39% | 97.33% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.55% | 92.86% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.46% | 94.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.24% | 91.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.13% | 90.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.08% | 96.47% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 83.78% | 98.44% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.37% | 98.05% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.20% | 96.90% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.15% | 93.56% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.94% | 89.44% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.86% | 98.33% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 82.72% | 93.89% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 81.88% | 95.69% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 81.80% | 95.36% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.36% | 95.50% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.55% | 90.08% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.34% | 93.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.09% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium minutiflorum |
| PubChem | 162800513 |
| LOTUS | LTS0082467 |
| wikiData | Q105380078 |