(1S,5S,6R,9R,10R)-10-hydroxy-5,10-dimethyl-5-[4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]pent-4-enyl]tricyclo[7.2.1.01,6]dodecan-4-one
Internal ID | e7af0e0e-5481-4b6b-8589-2e841bd89337 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | (1S,5S,6R,9R,10R)-10-hydroxy-5,10-dimethyl-5-[4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]pent-4-enyl]tricyclo[7.2.1.01,6]dodecan-4-one |
SMILES (Canonical) | CC1(CC23CCC(=O)C(C2CCC1C3)(C)CCCC(=C)COC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | C[C@]1(C[C@@]23CCC(=O)[C@@]([C@@H]2CC[C@@H]1C3)(C)CCCC(=C)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
InChI | InChI=1S/C26H42O8/c1-15(13-33-23-22(31)21(30)20(29)17(12-27)34-23)5-4-9-24(2)18-7-6-16-11-26(18,10-8-19(24)28)14-25(16,3)32/h16-18,20-23,27,29-32H,1,4-14H2,2-3H3/t16-,17-,18+,20-,21+,22-,23-,24+,25-,26+/m1/s1 |
InChI Key | VYCNNHSABARBKP-LGIJOVBMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H42O8 |
Molecular Weight | 482.60 g/mol |
Exact Mass | 482.28796829 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of (1S,5S,6R,9R,10R)-10-hydroxy-5,10-dimethyl-5-[4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]pent-4-enyl]tricyclo[7.2.1.01,6]dodecan-4-one 2D Structure of (1S,5S,6R,9R,10R)-10-hydroxy-5,10-dimethyl-5-[4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]pent-4-enyl]tricyclo[7.2.1.01,6]dodecan-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/48a90550-84a7-11ee-b547-a590ab23881c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.73% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.68% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.48% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.03% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.80% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.42% | 96.61% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.17% | 96.38% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.15% | 91.24% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.91% | 100.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 87.08% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.17% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.71% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.47% | 95.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.73% | 92.50% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 83.25% | 95.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.08% | 96.77% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.68% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.34% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.33% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.53% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pieris formosa |
PubChem | 162885266 |
LOTUS | LTS0070407 |
wikiData | Q105298888 |