1-[14,17-dihydroxy-3-[4-hydroxy-5-[5-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methoxyethanone
Internal ID | c42f4a6c-5037-47bc-95b1-d03bb5fa7989 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 1-[14,17-dihydroxy-3-[4-hydroxy-5-[5-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methoxyethanone |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3O)OC4CCC5(C6CCC7(C(C6CC=C5C4)(CCC7(C(=O)COC)O)O)C)C)C)C)OC)O |
SMILES (Isomeric) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3O)OC4CCC5(C6CCC7(C(C6CC=C5C4)(CCC7(C(=O)COC)O)O)C)C)C)C)OC)O |
InChI | InChI=1S/C42H68O14/c1-22-36(45)30(49-7)19-34(51-22)56-38-24(3)53-35(20-31(38)50-8)55-37-23(2)52-33(18-29(37)43)54-26-11-13-39(4)25(17-26)9-10-28-27(39)12-14-40(5)41(28,46)15-16-42(40,47)32(44)21-48-6/h9,22-24,26-31,33-38,43,45-47H,10-21H2,1-8H3 |
InChI Key | ATFJJJGUMPKSLU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H68O14 |
Molecular Weight | 797.00 g/mol |
Exact Mass | 796.46090684 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.36% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.21% | 91.11% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 96.09% | 95.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.98% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.14% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.97% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.35% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.65% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.98% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.88% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.77% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.70% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.18% | 91.07% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 86.50% | 87.16% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.22% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.07% | 95.89% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 84.03% | 94.50% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.08% | 96.38% |
CHEMBL5028 | O14672 | ADAM10 | 82.27% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.28% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.31% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.08% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 162897362 |
LOTUS | LTS0066972 |
wikiData | Q104918374 |