(2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5S,6R)-2-[[(1R,3aR,5aR,5bR,7aS,9R,10R,11aR,11bR,13aR,13bR)-10-hydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | c6ba5954-eb64-4a06-bdac-91d411d8b819 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5S,6R)-2-[[(1R,3aR,5aR,5bR,7aS,9R,10R,11aR,11bR,13aR,13bR)-10-hydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C(C3(CC2)C)(CCC5C4(CC(C(C5(C)C)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)O)C)C)C |
| SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@H]4[C@]([C@@]3(CC2)C)(CC[C@H]5[C@@]4(C[C@H]([C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)C)C)C |
| InChI | InChI=1S/C42H70O12/c1-20(2)21-11-13-39(5)15-16-41(7)22(28(21)39)9-10-27-40(6)17-23(45)35(38(3,4)26(40)12-14-42(27,41)8)54-37-34(32(49)30(47)25(19-44)52-37)53-36-33(50)31(48)29(46)24(18-43)51-36/h21-37,43-50H,1,9-19H2,2-8H3/t21-,22+,23+,24+,25+,26+,27+,28+,29+,30+,31-,32-,33+,34+,35-,36-,37-,39+,40-,41+,42+/m0/s1 |
| InChI Key | HJPIQGMZMGIUBT-LHJRREDESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H70O12 |
| Molecular Weight | 767.00 g/mol |
| Exact Mass | 766.48672766 g/mol |
| Topological Polar Surface Area (TPSA) | 199.00 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.68% | 96.61% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.00% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.75% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.94% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.48% | 94.45% |
| CHEMBL233 | P35372 | Mu opioid receptor | 93.83% | 97.93% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.03% | 92.94% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 92.52% | 91.24% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.30% | 95.89% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.12% | 96.38% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.81% | 96.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.12% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.67% | 97.79% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.48% | 95.58% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.11% | 95.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.64% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.03% | 98.95% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.63% | 98.10% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.93% | 97.53% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 84.80% | 91.83% |
| CHEMBL3589 | P55263 | Adenosine kinase | 84.62% | 98.05% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.95% | 97.50% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 83.45% | 85.83% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.37% | 92.62% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.12% | 95.38% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.94% | 95.89% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.89% | 82.50% |
| CHEMBL5331 | Q12866 | Proto-oncogene tyrosine-protein kinase MER | 82.59% | 91.67% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.43% | 95.36% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.30% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.23% | 94.75% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.17% | 91.03% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.05% | 99.17% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.01% | 95.83% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.74% | 91.49% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.57% | 100.00% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.52% | 97.50% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.78% | 97.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.50% | 86.33% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 80.27% | 97.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Leucas nutans |
| PubChem | 162870138 |
| LOTUS | LTS0095950 |
| wikiData | Q105029383 |