(1S,5S,6E,7S,14R,15R,16R,17R)-6-ethylidene-16-(hydroxymethyl)-14,17-dimethyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,8,12-trioxatricyclo[13.2.1.05,10]octadec-9-ene-3,11-dione
Internal ID | 0a22973f-f9fa-442f-b33c-e0231fc3edb8 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | (1S,5S,6E,7S,14R,15R,16R,17R)-6-ethylidene-16-(hydroxymethyl)-14,17-dimethyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,8,12-trioxatricyclo[13.2.1.05,10]octadec-9-ene-3,11-dione |
SMILES (Canonical) | CC=C1C2CC(=O)OC3CC(C(COC(=O)C2=COC1OC4C(C(C(C(O4)CO)O)O)O)C)C(C3C)CO |
SMILES (Isomeric) | C/C=C/1\[C@@H]2CC(=O)O[C@H]3C[C@H]([C@H](COC(=O)C2=CO[C@H]1O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C)[C@H]([C@H]3C)CO |
InChI | InChI=1S/C26H38O12/c1-4-13-15-6-20(29)36-18-5-14(16(7-27)12(18)3)11(2)9-34-24(33)17(15)10-35-25(13)38-26-23(32)22(31)21(30)19(8-28)37-26/h4,10-12,14-16,18-19,21-23,25-28,30-32H,5-9H2,1-3H3/b13-4+/t11-,12+,14+,15-,16-,18-,19+,21+,22-,23+,25-,26-/m0/s1 |
InChI Key | UYXDHLVWIBOTCN-VSMLOBLDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H38O12 |
Molecular Weight | 542.60 g/mol |
Exact Mass | 542.23632664 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.22% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.06% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.68% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 90.83% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.10% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.93% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.47% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.33% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.85% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 86.15% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.70% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.37% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.51% | 100.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.50% | 89.34% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.13% | 97.79% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.66% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.11% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.27% | 99.23% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.17% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum nudiflorum |
PubChem | 163186984 |
LOTUS | LTS0198944 |
wikiData | Q105282015 |