4,8-Dimethoxy-8-(3-methylbutan-2-yl)furo[2,3-b]quinolin-7-one
| Internal ID | 48557883-8ed0-4673-9d6d-4c506dd33d51 |
| Taxonomy | Organoheterocyclic compounds > Furopyridines |
| IUPAC Name | 4,8-dimethoxy-8-(3-methylbutan-2-yl)furo[2,3-b]quinolin-7-one |
| SMILES (Canonical) | CC(C)C(C)C1(C(=O)C=CC2=C1N=C3C(=C2OC)C=CO3)OC |
| SMILES (Isomeric) | CC(C)C(C)C1(C(=O)C=CC2=C1N=C3C(=C2OC)C=CO3)OC |
| InChI | InChI=1S/C18H21NO4/c1-10(2)11(3)18(22-5)14(20)7-6-12-15(21-4)13-8-9-23-17(13)19-16(12)18/h6-11H,1-5H3 |
| InChI Key | GBVWIVASAJEPMZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 61.60 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of 4,8-Dimethoxy-8-(3-methylbutan-2-yl)furo[2,3-b]quinolin-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/48-dimethoxy-8-3-methylbutan-2-ylfuro23-bquinolin-7-one.jpg "2D Structure of 4,8-Dimethoxy-8-(3-methylbutan-2-yl)furo[2,3-b]quinolin-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.45% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.76% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.42% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.40% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.91% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.15% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.72% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.13% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.85% | 94.73% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.52% | 96.77% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.50% | 93.10% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.07% | 96.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.27% | 99.15% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.04% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplophyllum acutifolium |
| Juniperus communis |
| Juniperus drupacea |
| PubChem | 162886539 |
| LOTUS | LTS0080252 |
| wikiData | Q82862567 |