4,8-Dihydroxy-5-methoxy-6,10-dimethyl-4a,9a-dihydroacridin-9-one
| Internal ID | 19882672-6271-4420-a7d8-c252e11f5f5b |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines |
| IUPAC Name | 4,8-dihydroxy-5-methoxy-6,10-dimethyl-4a,9a-dihydroacridin-9-one |
| SMILES (Canonical) | CC1=CC(=C2C(=O)C3C=CC=C(C3N(C2=C1OC)C)O)O |
| SMILES (Isomeric) | CC1=CC(=C2C(=O)C3C=CC=C(C3N(C2=C1OC)C)O)O |
| InChI | InChI=1S/C16H17NO4/c1-8-7-11(19)12-14(16(8)21-3)17(2)13-9(15(12)20)5-4-6-10(13)18/h4-7,9,13,18-19H,1-3H3 |
| InChI Key | BNELQOMUHVULHA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11575802 g/mol |
| Topological Polar Surface Area (TPSA) | 70.00 Ų |
| XlogP | 2.70 |
| 9(8aH)-Acridinone, 10,10a-dihydro-1,5-dihydroxy-4-methoxy-3,10-dimethyl- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.28% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.45% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.99% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.92% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.97% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.89% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.73% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.21% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.67% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.93% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.55% | 91.49% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.99% | 80.78% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.95% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.72% | 83.82% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.59% | 93.65% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.60% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Swinglea glutinosa |
| PubChem | 5276835 |
| LOTUS | LTS0197072 |
| wikiData | Q105100890 |