4,8-Dihydroxy-3-hydroxymethyl-4xi-methyl-1,4-dihydronaphthalene-1-one
| Internal ID | 2fe639e8-60f8-42fb-ab6a-abece2e831ff |
| Taxonomy | Benzenoids > Naphthalenes |
| IUPAC Name | 4,8-dihydroxy-3-(hydroxymethyl)-4-methylnaphthalen-1-one |
| SMILES (Canonical) | CC1(C2=C(C(=CC=C2)O)C(=O)C=C1CO)O |
| SMILES (Isomeric) | CC1(C2=C(C(=CC=C2)O)C(=O)C=C1CO)O |
| InChI | InChI=1S/C12H12O4/c1-12(16)7(6-13)5-10(15)11-8(12)3-2-4-9(11)14/h2-5,13-14,16H,6H2,1H3 |
| InChI Key | YONLIYCLDYCHEV-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.13% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.85% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.65% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.62% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.20% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.55% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.42% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.57% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.03% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.00% | 99.23% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.12% | 82.69% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.51% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11564791 |
| LOTUS | LTS0094234 |
| wikiData | Q75064417 |