(1S,8S,10S,12R)-10-[(2S,3S,5S)-5-(furan-3-yl)-2-hydroxyoxolan-3-yl]-10,12-dimethyl-2,9-dioxatricyclo[6.3.1.04,12]dodec-4-en-3-one
Internal ID | bab47022-e80b-4204-ba21-3975a7c7c114 |
Taxonomy | Organoheterocyclic compounds > Oxanes |
IUPAC Name | (1S,8S,10S,12R)-10-[(2S,3S,5S)-5-(furan-3-yl)-2-hydroxyoxolan-3-yl]-10,12-dimethyl-2,9-dioxatricyclo[6.3.1.04,12]dodec-4-en-3-one |
SMILES (Canonical) | CC1(CC2C3(C(O1)CCC=C3C(=O)O2)C)C4CC(OC4O)C5=COC=C5 |
SMILES (Isomeric) | C[C@]1(C[C@H]2[C@]3([C@@H](O1)CCC=C3C(=O)O2)C)[C@@H]4C[C@H](O[C@@H]4O)C5=COC=C5 |
InChI | InChI=1S/C20H24O6/c1-19(13-8-14(24-18(13)22)11-6-7-23-10-11)9-16-20(2)12(17(21)25-16)4-3-5-15(20)26-19/h4,6-7,10,13-16,18,22H,3,5,8-9H2,1-2H3/t13-,14+,15+,16+,18+,19+,20-/m1/s1 |
InChI Key | ZTZQURAKDHKLSW-KNEKMNIZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H24O6 |
Molecular Weight | 360.40 g/mol |
Exact Mass | 360.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 78.10 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of (1S,8S,10S,12R)-10-[(2S,3S,5S)-5-(furan-3-yl)-2-hydroxyoxolan-3-yl]-10,12-dimethyl-2,9-dioxatricyclo[6.3.1.04,12]dodec-4-en-3-one 2D Structure of (1S,8S,10S,12R)-10-[(2S,3S,5S)-5-(furan-3-yl)-2-hydroxyoxolan-3-yl]-10,12-dimethyl-2,9-dioxatricyclo[6.3.1.04,12]dodec-4-en-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/47aabf80-8565-11ee-b954-e52fb7e98482.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.74% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.85% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.17% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.19% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.10% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.85% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.46% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.20% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.62% | 90.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.77% | 95.93% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.18% | 97.14% |
CHEMBL2581 | P07339 | Cathepsin D | 82.62% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.32% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.53% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.21% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.04% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Syzygiella autumnalis |
PubChem | 100982700 |
LOTUS | LTS0096895 |
wikiData | Q105383403 |