2-[[(11R,12R)-12-[(14R,15S,19R)-2,3,4,7,8,9,19-heptahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1,3,5(18),6,8,10-hexaen-14-yl]-3,4,17,18,19-pentahydroxy-8,14-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-5-yl]oxy]-3,4,5-trihydroxybenzoic acid
Internal ID | c7cb66be-ad4d-4e09-b5ff-0fa571658236 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[[(11R,12R)-12-[(14R,15S,19R)-2,3,4,7,8,9,19-heptahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1,3,5(18),6,8,10-hexaen-14-yl]-3,4,17,18,19-pentahydroxy-8,14-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-5-yl]oxy]-3,4,5-trihydroxybenzoic acid |
SMILES (Canonical) | C1C(C(OC(=O)C2=CC(=C(C(=C2C3=C(C(=C(C=C3C(=O)O1)OC4=C(C(=C(C=C4C(=O)O)O)O)O)O)O)O)O)O)C5C6C(C7=C(C(=C(C(=C7C(=O)O6)C8=C(C(=C(C=C8C(=O)O5)O)O)O)O)O)O)O)OC(=O)C9=CC(=C(C(=C9)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@@H](OC(=O)C2=CC(=C(C(=C2C3=C(C(=C(C=C3C(=O)O1)OC4=C(C(=C(C=C4C(=O)O)O)O)O)O)O)O)O)O)[C@H]5[C@@H]6[C@@H](C7=C(C(=C(C(=C7C(=O)O6)C8=C(C(=C(C=C8C(=O)O5)O)O)O)O)O)O)O)OC(=O)C9=CC(=C(C(=C9)O)O)O |
InChI | InChI=1S/C48H32O31/c49-13-1-8(2-14(50)26(13)54)44(69)76-19-7-74-45(70)11-6-18(75-39-12(43(67)68)5-17(53)29(57)38(39)66)30(58)33(61)21(11)20-9(3-15(51)27(55)31(20)59)46(71)77-40(19)42-41-36(64)25-24(48(73)78-41)23(34(62)37(65)35(25)63)22-10(47(72)79-42)4-16(52)28(56)32(22)60/h1-6,19,36,40-42,49-66H,7H2,(H,67,68)/t19-,36-,40-,41+,42+/m1/s1 |
InChI Key | ICGSOLGBHDVXJA-HRQCHSRESA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H32O31 |
Molecular Weight | 1104.70 g/mol |
Exact Mass | 1104.09275422 g/mol |
Topological Polar Surface Area (TPSA) | 542.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.33% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.27% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.78% | 83.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.60% | 95.17% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 94.58% | 94.42% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.84% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.81% | 99.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.75% | 97.21% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.57% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 93.07% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.60% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.41% | 86.33% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 90.16% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 89.33% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.17% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.53% | 98.95% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.85% | 95.78% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 84.33% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.42% | 95.50% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 83.26% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.18% | 89.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.98% | 96.38% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.49% | 93.00% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.01% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Elaeagnus umbellata |
PubChem | 162936314 |
LOTUS | LTS0097236 |
wikiData | Q105110970 |