[20-Acetyloxy-6-(furan-3-yl)-4,8,18-trihydroxy-5,10,14-trimethyl-3-oxo-16,21-dioxahexacyclo[12.3.3.19,11.01,13.02,10.05,9]henicosan-15-yl] 2-methylpropanoate
Internal ID | e0c37b2e-4133-4288-a18a-b279fe60b827 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [20-acetyloxy-6-(furan-3-yl)-4,8,18-trihydroxy-5,10,14-trimethyl-3-oxo-16,21-dioxahexacyclo[12.3.3.19,11.01,13.02,10.05,9]henicosan-15-yl] 2-methylpropanoate |
SMILES (Canonical) | CC(C)C(=O)OC1C2(C3CC4C5(C(C3(CO1)C(CC2OC(=O)C)O)C(=O)C(C6(C5(O4)C(CC6C7=COC=C7)O)C)O)C)C |
SMILES (Isomeric) | CC(C)C(=O)OC1C2(C3CC4C5(C(C3(CO1)C(CC2OC(=O)C)O)C(=O)C(C6(C5(O4)C(CC6C7=COC=C7)O)C)O)C)C |
InChI | InChI=1S/C32H42O11/c1-14(2)26(38)42-27-28(4)18-10-22-30(6)24(31(18,13-40-27)19(34)11-21(28)41-15(3)33)23(36)25(37)29(5)17(16-7-8-39-12-16)9-20(35)32(29,30)43-22/h7-8,12,14,17-22,24-25,27,34-35,37H,9-11,13H2,1-6H3 |
InChI Key | JICAVWDTFZENFS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H42O11 |
Molecular Weight | 602.70 g/mol |
Exact Mass | 602.27271215 g/mol |
Topological Polar Surface Area (TPSA) | 162.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
![2D Structure of [20-Acetyloxy-6-(furan-3-yl)-4,8,18-trihydroxy-5,10,14-trimethyl-3-oxo-16,21-dioxahexacyclo[12.3.3.19,11.01,13.02,10.05,9]henicosan-15-yl] 2-methylpropanoate 2D Structure of [20-Acetyloxy-6-(furan-3-yl)-4,8,18-trihydroxy-5,10,14-trimethyl-3-oxo-16,21-dioxahexacyclo[12.3.3.19,11.01,13.02,10.05,9]henicosan-15-yl] 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/47485de0-84dc-11ee-bc95-8bae07397233.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.03% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.48% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.46% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.84% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.82% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.79% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.57% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.14% | 92.62% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 89.07% | 97.28% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.79% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.75% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.02% | 91.19% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.38% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.75% | 97.25% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.77% | 95.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.68% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.43% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.21% | 94.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.34% | 91.07% |
CHEMBL5028 | O14672 | ADAM10 | 80.12% | 97.50% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.12% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 73236264 |
LOTUS | LTS0071854 |
wikiData | Q105128916 |